linifanib

{{Short description|Chemical compound}}

{{cs1 config |name-list-style=vanc |display-authors=6}}

{{drugbox

| verifiedrevid = 416014858

| IUPAC_name = 1-[4-(3-amino-1H-indazol-4-yl)phenyl]-3-(2-fluoro-5-methylphenyl)urea

| image = Linifanib skeletal.svg

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID =9660475

| StdInChI=1S/C21H18FN5O/c1-12-5-10-16(22)18(11-12)25-21(28)24-14-8-6-13(7-9-14)15-3-2-4-17-19(15)20(23)27-26-17/h2-11H,1H3,(H3,23,26,27)(H2,24,25,28)

| smiles = Cc1ccc(F)c(NC(=O)Nc2ccc(-c3cccc4[nH]nc(N)c34)cc2)c1

| StdInChIKey = MPVGZUGXCQEXTM-UHFFFAOYSA-N

| CAS_number = 796967-16-3

| ChEBI = 91435

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 223360

| ATC_prefix = None

| ATC_suffix =

| ATC_supplemental =

| UNII = CO93X137CW

| PubChem = 11485656

| IUPHAR_ligand = 5657

| DrugBank =

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D09635

| C=17 | H=15 | F=1 | N=5 | O=1

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| pregnancy_category =

| legal_status = Investigational

| routes_of_administration =

}}

Linifanib (ABT-869) is a structurally novel, potent inhibitor of receptor tyrosine kinases (RTK), vascular endothelial growth factor (VEGF) and platelet-derived growth factor (PDGF) with IC50 of 0.2, 2, 4, and 7 nM for human endothelial cells, PDGF receptor beta (PDGFR-β), KDR, and colony stimulating factor 1 receptor (CSF-1R), respectively. It has much less activity (IC50s > 1 μM) against unrelated RTKs, soluble tyrosine kinases, or serine/threonine kinases. In vivo linifanib is effective orally in mechanism-based murine models of VEGF-induced uterine edema (ED50 = 0.5 mg/kg) and corneal angiogenesis (>50%inhibition, 15 mg/kg).{{cite journal | vauthors = Albert DH, Tapang P, Magoc TJ, Pease LJ, Reuter DR, Wei RQ, Li J, Guo J, Bousquet PF, Ghoreishi-Haack NS, Wang B, Bukofzer GT, Wang YC, Stavropoulos JA, Hartandi K, Niquette AL, Soni N, Johnson EF, McCall JO, Bouska JJ, Luo Y, Donawho CK, Dai Y, Marcotte PA, Glaser KB, Michaelides MR, Davidsen SK | title = Preclinical activity of ABT-869, a multitargeted receptor tyrosine kinase inhibitor | journal = Molecular Cancer Therapeutics | volume = 5 | issue = 4 | pages = 995–1006 | date = April 2006 | pmid = 16648571 | doi = 10.1158/1535-7163.MCT-05-0410 | doi-access = }}{{cite journal | vauthors = Guo J, Marcotte PA, McCall JO, Dai Y, Pease LJ, Michaelides MR, Davidsen SK, Glaser KB | title = Inhibition of phosphorylation of the colony-stimulating factor-1 receptor (c-Fms) tyrosine kinase in transfected cells by ABT-869 and other tyrosine kinase inhibitors | journal = Molecular Cancer Therapeutics | volume = 5 | issue = 4 | pages = 1007–1013 | date = April 2006 | pmid = 16648572 | doi = 10.1158/1535-7163.MCT-05-0359 | doi-access = free }}

The substance has been used as part of a chemical cocktail to turn old and senescent human cells back into young ones (as measured by transcriptomic age), without turning them all the way back into undifferentiated stem cells.{{cite journal | vauthors = Yang JH, Petty CA, Dixon-McDougall T, Lopez MV, Tyshkovskiy A, Maybury-Lewis S, Tian X, Ibrahim N, Chen Z, Griffin PT, Arnold M, Li J, Martinez OA, Behn A, Rogers-Hammond R, Angeli S, Gladyshev VN, Sinclair DA | title = Chemically induced reprogramming to reverse cellular aging | journal = Aging | volume = 15 | issue = 13 | pages = 5966–5989 | date = July 2023 | pmid = 37437248 | pmc = 10373966 | doi = 10.18632/aging.204896 }}

References