lithium bicarbonate

{{Chembox

| ImageFile = Lithium bicarbonate.svg

| ImageSize = 200px

| PIN = Lithium hydrogen carbonate

|Section1={{Chembox Identifiers

| PubChem = 23678576

| CASNo = 5006-97-3

| ChemSpiderID = 7969455

| UNII = K73H191F56

| StdInChI=1S/CH2O3.Li/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1

| StdInChIKey = HQRPHMAXFVUBJX-UHFFFAOYSA-M

| SMILES = [Li+].C(=O)(O)[O-]

}}

|Section2={{Chembox Properties

|C=1|H=1|Li=1|O=3

}}

}}

Lithium bicarbonate (LiHCO₃) is a compound of lithium, hydrogen, carbon and oxygen.{{cite web | work = PubChem | publisher = National Library of Medicine (US), National Center for Biotechnology Information | date = 2004 | title = PubChem Compound Summary for CID 23678576, Lithium bicarbonate | access-date = January 3, 2021 | url = https://pubchem.ncbi.nlm.nih.gov/compound/Lithium-bicarbonate }}