lithium borate

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 403180805

| ImageFile1 = EntryWithCollCode419669.png

| Name = Lithium tetraborate

| ImageFile =

| OtherNames = Lithium borate

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 21169645

| InChI = 1/B4O7.2Li/c5-1-9-3(7)11-4(8)10-2-6;;/q-2;2*+1

| InChIKey = PSHMSSXLYVAENJ-UHFFFAOYAA

| SMILES = [Li+].[Li+].O=BOB([O-])OB([O-])OB=O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/B4O7.2Li/c5-1-9-3(7)11-4(8)10-2-6;;/q-2;2*+1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = PSHMSSXLYVAENJ-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 12007-60-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = G5N01T5TYY

| EINECS = 234-514-3

| PubChem = 15764247

}}

|Section2={{Chembox Properties

| Formula = Li₂B₄O₇

| MolarMass = 169.11 g/mol

| Appearance = white powder

| Density = 2.4 g/cm³, solid

| Solubility = moderately soluble

| MeltingPtC = 917

| BoilingPt =

}}

|Section7={{Chembox Hazards

| ExternalSDS = [http://www.physchem.ox.ac.uk/MSDS/LI/lithium_borate.html External MSDS]

| NFPA-H = 2

| NFPA-R = 0

| NFPA-F = 0

}}

}}

Lithium borate,[https://www.chemspider.com/Chemical-Structure.21169645.html Lithium borate] also known as lithium tetraborate,[https://commonchemistry.cas.org/detail?cas_rn=12007-60 Boron lithium oxide] dilithium tetraborate[https://webbook.nist.gov/cgi/cbook.cgi?ID=C12007602 dilithium tetraborate] or boron lithium oxide is an inorganic compound with the formula Li₂B₄O₇. A colorless solid, lithium borate is used in making glasses and ceramics. It is not to be confused with B₈Li₂O₁₃, also called lithium borate.[https://webbook.nist.gov/cgi/cbook.cgi?ID=C12008401 Lithium borate]