lithium stearate

{{Chembox

| Name = Lithium stearate

| ImageFile =Lithium stearate.svg

| ImageSize =250px

| PIN = Lithium octadecanoate

| OtherNames =

|Section1={{Chembox Identifiers

| Abbreviations =

| CASNo =4485-12-5

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = P31MC94P70

| EINECS = 224-772-5

| PubChem = 20569

| ChemSpiderID = 19369

| SMILES = [Li+].[O-]C(=O)CCCCCCCCCCCCCCCCC

| InChI = InChI=1S/C18H36O2.Li/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h2-17H2,1H3,(H,19,20);/q;+1/p-1

| RTECS =

| MeSHName =

| ChEBI =

| KEGG =

}}

|Section2={{Chembox Properties

| C=18 | H=35 | Li=1 | O=2

| Appearance =

| Density =

| MeltingPt =

| MeltingPt_notes =

| BoilingPt =

| BoilingPt_notes =

| Solubility =

| SolubleOther =

| Solvent =

| LogP =

| VaporPressure =

| HenryConstant =

| AtmosphericOHRateConstant =

| pKa =

| pKb =

}}

|Section3={{Chembox Structure

| CrystalStruct =

| Coordination =

| MolShape =

}}

|Section4={{Chembox Thermochemistry

| DeltaHf =

| DeltaHc =

| Entropy =

| HeatCapacity =

}}

|Section5={{Chembox Pharmacology

| AdminRoutes =

| Bioavail =

| Metabolism =

| HalfLife =

| ProteinBound =

| Excretion =

| Legal_status =

| Legal_US =

| Legal_UK =

| Legal_AU =

| Legal_CA =

| Pregnancy_category =

| Pregnancy_AU =

| Pregnancy_US =

}}

|Section6={{Chembox Explosive

| ShockSens =

| FrictionSens =

| DetonationV =

| REFactor =

}}

|Section7={{Chembox Hazards

| ExternalSDS =

| MainHazards =

| NFPA-H =

| NFPA-F =

| NFPA-R =

| NFPA-S =

| FlashPt =

| AutoignitionPt =

| ExploLimits =

| LD50 =

| PEL =

}}

|Section8={{Chembox Related

| OtherAnions =

| OtherCations =

| OtherFunction =

| OtherFunction_label =

| OtherCompounds =

}}

}}

Lithium stearate is a chemical compound with the formula LiO₂C(CH₂)₁₆CH₃. It is formally classified as a soap (a salt of a fatty acid). Lithium stearate is a white soft solid, prepared by the reaction of lithium hydroxide and stearic acid.

Lithium stearate and lithium 12-hydroxystearate are lithium soaps, and are components of lithium greases and release agents.{{Ullmann|doi=10.1002/14356007.a16_361|title=Metallic Soaps|year=2001|last1=Nora|first1=Angelo|last2=Szczepanek|first2=Alfred|last3=Koenen|first3=Gunther|isbn=3527306730}}