lividomycin

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = (1R,2R,3S,4R,6S)-4,6-Diamino-3-hydroxy-2-{[α-D-mannopyranosyl-(1->4)-2,6-diamino-2,6-dideoxy-β-L-idopyranosyl-(1->3)-β-D-ribofuranosyl]oxy}cyclohexyl 2-amino-2,3-dideoxy-α-D-ribo-hexopyranoside

| image = Lividomycin.svg

| CAS_number = 36441-41-5

| CAS_number_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = A606AJ494W

| ATC_prefix =

| ATC_suffix =

| PubChem = 72394

| DrugBank = DB04728

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 71961

| ChEMBL = 389029

| ChemSpiderID = 65327

| C=29 | H=55 | N=5 |O=19

| smiles = O([C@H]4[C@H](O[C@@H]3O[C@H](CO)[C@@H](O[C@H]2O[C@@H](CN)[C@@H](O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O)[C@H](O)[C@H]2N)[C@H]3O)[C@@H](O)[C@H](N)C[C@@H]4N)[C@H]5O[C@@H]([C@@H](O)C[C@H]5N)CO

| StdInChI = 1S/C29H55N5O18/c30-3-11-23(51-28-20(43)19(42)17(40)13(5-36)47-28)18(41)15(34)27(45-11)50-24-14(6-37)48-29(21(24)44)52-25-16(39)7(31)1-8(32)22(25)49-26-9(33)2-10(38)12(4-35)46-26/h7-29,35-44H,1-6,30-34H2/t7-,8+,9-,10+,11+,12-,13-,14-,15-,16+,17-,18-,19+,20+,21-,22-,23-,24-,25-,26-,27-,28-,29+/m1/s1

| StdInChIKey = DBLVDAUGBTYDFR-SWMBIRFSSA-N

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category=

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

}}

Lividomycin is a broad-spectrum aminoglycoside antibiotic.{{cite journal | vauthors = Kobayashi F, Yamaguchi M, Mitsuhashi S | title = Activity of lividomycin against Pseudomonas aeruginosa: its inactivation by phosphorylation induced by resistant strains | journal = Antimicrobial Agents and Chemotherapy | volume = 1 | issue = 1 | pages = 17–21 | date = January 1972 | pmid = 4207755 | pmc = 444159 | doi = 10.1128/AAC.1.1.17 }} It is effective against most Gram-positive and Gram-negative bacteria including Mycobacterium tuberculosis (the causative agent of tuberculosis) and Pseudomonas aeruginosa.{{cite journal | vauthors = Kobayashi F, Nagoya T, Yoshimura Y, Kaneko K, Ogata SI | title = Studies on New Antibiotic Lividomycins. V In vitro and in vivo antimicrobial activity of lividomycin A | journal = The Journal of Antibiotics | volume = 25 | issue = 2 | pages = 128–136 | date = February 1972 | pmid = 4624613 | doi = 10.7164/antibiotics.25.128 | doi-access = free }}