loganin

{{Chembox

| ImageFile = Loganin structure.svg

| ImageSize = 200px

| ImageAlt =

| ImageFile2 = Loganin 3D BS.png

| ImageSize2 = 200px

| ImageAlt2 =

| IUPACName = Methyl (1S,4aS,6S,7R,7aS)-1-(β-D-glucopyranosyloxy)-6-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate

| SystematicName = Methyl (1S,4aS,6S,7R,7aS)-6-hydroxy-7-methyl-1-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate

| OtherNames = Loganoside

|Section1={{Chembox Identifiers

| CASNo = 18524-94-2

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = H7WJ16Q93C

| PubChem = 87691

| ChEBI = 15771

| SMILES = C[C@H]1[C@H](C[C@H]2[C@@H]1[C@@H](OC=C2C(=O)OC)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O

| StdInChI = 1S/C17H26O10/c1-6-9(19)3-7-8(15(23)24-2)5-25-16(11(6)7)27-17-14(22)13(21)12(20)10(4-18)26-17/h5-7,9-14,16-22H,3-4H2,1-2H3/t6-,7+,9-,10+,11+,12+,13-,14+,16-,17-/m0/s1

| StdInChIKey = AMBQHHVBBHTQBF-UOUCRYGSSA-N

| EINECS = 242-398-0

| ChemSpiderID = 79111

| InChI = 1/C17H26O10/c1-6-9(19)3-7-8(15(23)24-2)5-25-16(11(6)7)27-17-14(22)13(21)12(20)10(4-18)26-17/h5-7,9-14,16-22H,3-4H2,1-2H3/t6-,7+,9-,10+,11+,12+,13-,14+,16-,17-/m0/s1

| InChIKey = AMBQHHVBBHTQBF-UOUCRYGSBL

| RTECS =

| MeSHName =

| KEGG = C01433}}

|Section2={{Chembox Properties

| C=17 | H=26 | O=10

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Loganin is one of the best-known of the iridoid glycosides. It is named for the Loganiaceae, having first been isolated from the seeds of a member of that plant family, namely those of Strychnos nux-vomica. It also occurs in Alstonia boonei (Apocynaceae),{{cite journal | last1 = Adotey | first1 = J. P. | last2 = Adukpo | first2 = G. E. | last3 = Opoku-Boahen | first3 = Y. | last4 = Armah | first4 = F. A. | title = A Review of the Ethnobotany and Pharmacological Importance of Alstonia boonei De Wild (Apocynaceae) | journal = ISRN Pharmacology | year = 2012 | volume = 2012 | pages = 587160 | doi = 10.5402/2012/587160 | pmid = 22900200 | pmc = 3413980 | doi-access = free }} a medicinal tree of West Africa and in the medicinal/entheogenic shrub Desfontainia spinosa (Columelliaceae) native to Central America and South America.

Biosynthesis

Loganin is formed from loganic acid by the enzyme loganic acid O-methyltransferase (LAMT). Loganin then becomes a substrate for the enzyme secologanin synthase (SLS) to form secologanin, a secoiridoid monoterpene found as part of ipecac and terpene indole alkaloids.

References