lorajmine
{{Short description|Chemical compound}}
{{Drugbox
| verifiedrevid = 447635722
| IUPAC_name = (17R,21β)-ajmalan-17,21-diol 17-chloroacetate
OR
(1R,9R,10S,13R,14R,16S,18S)-13-ethyl-8-methyl-14-hydroxy-8,15-diazahexacyclo [14.2.1.01,9.02,7.010,15.012,17]nonadeca-2(7),3,5-triene-18-yl chloroacetate
| image = Lorajmine skeletal.svg
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 47562-08-3
| CAS_supplemental =
| ATC_prefix = C01
| ATC_suffix = BA12
| ATC_supplemental =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 16735878
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C22H27ClN2O3/c1-3-11-12-8-15-19-22(13-6-4-5-7-14(13)24(19)2)9-16(25(15)21(11)27)18(12)20(22)28-17(26)10-23/h4-7,11-12,15-16,18-21,27H,3,8-10H2,1-2H3/t11-,12-,15-,16-,18?,19-,20+,21+,22+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = LAHDERDHXJFFJU-KBFYUGGWSA-N
| PubChem = 76957773
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = F96VX65849
| ChEMBL = 2111031
| chemical_formula =
| C=22 | H=27 | Cl=1 | N=2 | O=3
| smiles = CCC1C2CC3C4C5(CC(C2C5C(=O)OCCl)N3C1O)C6=CC=CC=C6N4C
}}
Lorajmine (17-monochloroacetylajmaline) is a drug that is a potent sodium channel blocker (more specifically, a class Ia antiarrhythmic agent) that was used for treating arrhythmia.[http://www.online-medical-dictionary.org/?q=Lorajmine Medical Dictionary Online: Lorajmine]World Health Organization: [http://www.whocc.no/atc_ddd_index/?code=C01BA ATC/DDD Index]{{cite journal | vauthors = Sanna G, Meoli P, Bianchini C, Rovelli F | title = Antiarrhythmic effectiveness of propafenone compared to lorajmine in ventricular arrhythmias. Controlled clinical trial | journal = Giornale Italiano di Cardiologia | volume = 13 | issue = 3 | pages = 145–51 | date = 1983 | pmid = 6350090 | doi = | url = }} It is derived from ajmaline, an alkaloid from the roots of Rauvolfia serpentina, by synthetically adding a chloroacetate residue.