lorajmine

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 447635722

| IUPAC_name = (17R,21β)-ajmalan-17,21-diol 17-chloroacetate
OR
(1R,9R,10S,13R,14R,16S,18S)-13-ethyl-8-methyl-14-hydroxy-8,15-diazahexacyclo [14.2.1.01,9.02,7.010,15.012,17]nonadeca-2(7),3,5-triene-18-yl chloroacetate

| image = Lorajmine skeletal.svg

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 47562-08-3

| CAS_supplemental =

| ATC_prefix = C01

| ATC_suffix = BA12

| ATC_supplemental =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 16735878

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C22H27ClN2O3/c1-3-11-12-8-15-19-22(13-6-4-5-7-14(13)24(19)2)9-16(25(15)21(11)27)18(12)20(22)28-17(26)10-23/h4-7,11-12,15-16,18-21,27H,3,8-10H2,1-2H3/t11-,12-,15-,16-,18?,19-,20+,21+,22+/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = LAHDERDHXJFFJU-KBFYUGGWSA-N

| PubChem = 76957773

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = F96VX65849

| ChEMBL = 2111031

| chemical_formula =

| C=22 | H=27 | Cl=1 | N=2 | O=3

| smiles = CCC1C2CC3C4C5(CC(C2C5C(=O)OCCl)N3C1O)C6=CC=CC=C6N4C

}}

Lorajmine (17-monochloroacetylajmaline) is a drug that is a potent sodium channel blocker (more specifically, a class Ia antiarrhythmic agent) that was used for treating arrhythmia.[http://www.online-medical-dictionary.org/?q=Lorajmine Medical Dictionary Online: Lorajmine]World Health Organization: [http://www.whocc.no/atc_ddd_index/?code=C01BA ATC/DDD Index]{{cite journal | vauthors = Sanna G, Meoli P, Bianchini C, Rovelli F | title = Antiarrhythmic effectiveness of propafenone compared to lorajmine in ventricular arrhythmias. Controlled clinical trial | journal = Giornale Italiano di Cardiologia | volume = 13 | issue = 3 | pages = 145–51 | date = 1983 | pmid = 6350090 | doi = | url = }} It is derived from ajmaline, an alkaloid from the roots of Rauvolfia serpentina, by synthetically adding a chloroacetate residue.

References