lorbamate
{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name = 2-[(carbamoyloxy)methyl]-2-methylpentyl cyclopropylcarbamate
| image = Lorbamate.svg
| image_class = skin-invert-image
| CAS_number = 24353-88-6
| ATC_prefix = None
| ATC_suffix =
| UNII = J719A09W1G
| PubChem = 32322
| ChemSpiderID = 29962
| C = 12 | H = 22 | N = 2 | O = 4
| smiles = O=C(OCC(C)(CCC)COC(=O)N)NC1CC1
| StdInChI = 1S/C12H22N2O4/c1-3-6-12(2,7-17-10(13)15)8-18-11(16)14-9-4-5-9/h9H,3-8H2,1-2H3,(H2,13,15)(H,14,16)
| StdInChIKey = PTEUWWFEEPASRM-UHFFFAOYSA-N
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| pregnancy_category =
| legal_status =
| routes_of_administration =
}}
Lorbamate (INN; Abbott-19,957){{US Patent|3037045}} is a muscle relaxant and tranquilizer of the carbamate family which was never marketed.{{cite book | vauthors = Ganellin CR, Triggle DJ, Macdonald F | title = Dictionary of pharmacological agents | url = https://books.google.com/books?id=A0THacd46ZsC&pg=PA1234 | access-date = 26 November 2011 | year = 1997 | publisher = CRC Press | isbn = 978-0-412-46630-4 | pages = 1234}}{{cite web | url = http://whqlibdoc.who.int/hq/2004/WHO_EDM_QSM_2004.5.pdf | author = World Health Organization | title = The use of stems in the selection of International Nonproprietary Names (INN) for pharmaceutical substance | date = 2004 }}
See also
References
{{Reflist}}
{{Muscle relaxants}}
{{Sedatives}}
{{GABAAR PAMs}}
Category:GABAA receptor positive allosteric modulators
Category:Cyclopropyl compounds
{{Sedative-stub}}