lorglumide

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 405761835

| IUPAC_name = N²-(3,4-Dichlorobenzoyl-N,N-dipentyl-α-glutamine

| image = Lorglumide.png

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 97964-56-2

| ATC_prefix = none

| ATC_suffix =

| PubChem = 3960

| IUPHAR_ligand = 891

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = LAD1UQ73BE

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 24938

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 88305

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 3823

| C=22 | H=32 | Cl=2 | N=2 | O=4

| synonyms = 4-[(3,4-dichlorobenzoyl)amino]-5-(dipentylamino)-5-oxopentanoic acid

| smiles = CCCCCN(CCCCC)C(=O)C(CCC(=O)O)NC(=O)C1=CC(=C(C=C1)Cl)Cl

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C22H32Cl2N2O4/c1-3-5-7-13-26(14-8-6-4-2)22(30)19(11-12-20(27)28)25-21(29)16-9-10-17(23)18(24)15-16/h9-10,15,19H,3-8,11-14H2,1-2H3,(H,25,29)(H,27,28)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = IEKOTSCYBBDIJC-UHFFFAOYSA-N

}}

Lorglumide (CR-1409) is a drug which inhibits gastrointestinal motility and reduces gastric secretions, acting as a cholecystokinin antagonist,{{cite journal | vauthors = Makovec F, Bani M, Cereda R, Chisté R, Pacini MA, Revel L, Rovati LA, Rovati LC, Setnikar I | display-authors = 6 | title = Pharmacological properties of lorglumide as a member of a new class of cholecystokinin antagonists | journal = Arzneimittel-Forschung | volume = 37 | issue = 11 | pages = 1265–8 | date = November 1987 | pmid = 3440035 }} with fairly high selectivity for the CCK_A subtype.{{cite journal | vauthors = González-Puga C, García-Navarro A, Escames G, León J, López-Cantarero M, Ros E, Acuña-Castroviejo D | title = Selective CCK-A but not CCK-B receptor antagonists inhibit HT-29 cell proliferation: synergism with pharmacological levels of melatonin | journal = Journal of Pineal Research | volume = 39 | issue = 3 | pages = 243–50 | date = October 2005 | pmid = 16150104 | doi = 10.1111/j.1600-079X.2005.00239.x | s2cid = 20187767 }} It has been suggested as a potential treatment for a variety of gastrointestinal problems including stomach ulcers, irritable bowel syndrome, dyspepsia, constipation and pancreatitis, as well as some forms of cancer, but animal and human testing has produced inconsistent results and no clear therapeutic role has been established, although it is widely used in scientific research.{{cite journal | vauthors = de Tullio P, Delarge J, Pirotte B | title = Recent advances in the chemistry of cholecystokinin receptor ligands (agonists and antagonists) | journal = Current Medicinal Chemistry | volume = 6 | issue = 6 | pages = 433–55 | date = June 1999 | doi = 10.2174/0929867306666220330183253 | pmid = 10213792 | s2cid = 6031554 }}{{cite journal | vauthors = de Tullio P, Delarge J, Pirotte B | title = Therapeutic and chemical developments of cholecystokinin receptor ligands | journal = Expert Opinion on Investigational Drugs | volume = 9 | issue = 1 | pages = 129–46 | date = January 2000 | pmid = 11060666 | doi = 10.1517/13543784.9.1.129 | s2cid = 39985897 }}{{cite journal | vauthors = Herranz R | title = Cholecystokinin antagonists: pharmacological and therapeutic potential | journal = Medicinal Research Reviews | volume = 23 | issue = 5 | pages = 559–605 | date = September 2003 | pmid = 12789687 | doi = 10.1002/med.10042 | s2cid = 45758560 }}{{cite journal | vauthors = Berna MJ, Tapia JA, Sancho V, Jensen RT | title = Progress in developing cholecystokinin (CCK)/gastrin receptor ligands that have therapeutic potential | journal = Current Opinion in Pharmacology | volume = 7 | issue = 6 | pages = 583–92 | date = December 2007 | pmid = 17997137 | pmc = 2186776 | doi = 10.1016/j.coph.2007.09.011 }}