losindole
{{Short description|Tricyclic antidepressant}}
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Drugbox
| IUPAC_name = (3aS,4R,9aR)-6-chloro-2-methyl-4-phenyl-2,3,3a,4,9,9a-hexahydro-1H-benzo[f]isoindole
| image = Losindole.png
| tradename =
| pregnancy_category =
| legal_status = Uncontrolled
| routes_of_administration = Oral
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 69175-77-5
| ATC_prefix = none
| ATC_suffix =
| PubChem = 3045392
| ChemSpiderID = 2308134
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = IX8TM6153H
| C=19 | H=20 | Cl=1 | N=1
| smiles = Clc1ccc3c(c1)[C@@H](c2ccccc2)[C@H]4[C@@H](C3)CN(C4)C
}}
Losindole (BI-27,062) is an antidepressant with a tricyclic structure.{{Cite web |title=Losindole |url=https://drugs.ncats.io/drug/IX8TM6153H |access-date=2023-01-04 |website=NCATS Inxight Drugs}}{{cite book | vauthors = Triggle DJ | title = Dictionary of Pharmacological Agents | publisher = Chapman & Hall/CRC | location = Boca Raton | year = 1996 | isbn = 0-412-46630-9 | url = https://books.google.com/books?id=A0THacd46ZsC&q=losindole&pg=PA1236}} It was never marketed.
See also
References
{{Reflist}}
{{Antidepressants|state2=uncollapsed|abbr2=TCAs & TeCAs|selected=TCAs & TeCAs}}
{{Anxiolytics}}
{{Tricyclics}}