loviride

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 408580400

| IUPAC_name = 2-[(2-Acetyl-5-methylphenyl)amino]-2-(2,6-dichlorophenyl)acetamide

| image = Loviride.svg

| width = 175

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|CAS}}

| CAS_number = 147362-57-0

| ATC_prefix = None

| ATC_suffix =

| ATC_supplemental =

| PubChem = 3963

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 3826

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 3S1R1LZ09H

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D04786

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 37624

| C=17 | H=16 | Cl=2 | N=2 | O=2

| smiles = Clc1cccc(Cl)c1C(Nc2cc(ccc2C(=O)C)C)C(=O)N

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C17H16Cl2N2O2/c1-9-6-7-11(10(2)22)14(8-9)21-16(17(20)23)15-12(18)4-3-5-13(15)19/h3-8,16,21H,1-2H3,(H2,20,23)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = CJPLEFFCVDQQFZ-UHFFFAOYSA-N

| synonyms = R089439; loveride{{Citation needed|date=February 2010}}

}}

Loviride is an experimental antiviral drug manufactured by Janssen (now part of Janssen-Cilag) that is active against HIV. Loviride is a non-nucleoside reverse transcriptase inhibitor (NNRTI) that entered phase III clinical trials in the late 1990s, but failed to gain marketing approval because of poor potency.{{cite web | url = http://www.aidsmap.com/cms1032278.asp | title = Loviride | website = aidsmap.com | archive-url = https://web.archive.org/web/20070927192511/http://www.aidsmap.com/cms1032278.asp | archive-date = 2007-09-27 }} It is of clinical significance only in those patients who were enrolled in clinical trials to evaluate loviride (e.g., CAESAR{{cite journal | vauthors = Kroon ED, Wit FW | collaboration = CAESAR Coordinating Committee | doi = 10.1016/S0140-6736(97)04441-3 | title = Randomised trial of addition of lamivudine or lamivudine plus loviride to zidovudine-containing regimens for patients with HIV-1 infection: The CAESAR trial | journal = The Lancet | year = 1997 | volume = 349 | issue = 9063 | pages = 1413–1421 | s2cid = 20008082 | url = https://dare.uva.nl/personal/pure/en/publications/randomised-trial-of-addition-of-lamivudine-or-lamivudine-plus-loviride-to-zidovudinecontaining-regimens-for-patients-with-hiv1-infection-the-caesar-trial(60592251-8bcd-4787-8c25-b7115864937b).html }} and AVANTI{{cite journal | vauthors = Gatell J, Lange J, Gartland M | title = AVANTI 1: randomized, double-blind trial to evaluate the efficacy and safety of zidovudine plus lamivudine versus zidovudine plus lamivudine plus loviride in HIV-infected antiretroviral-naive patients. AVANTI Study Group | journal = Antiviral Therapy | volume = 4 | issue = 2 | pages = 79–86 | year = 1999 | pmid = 10682152 | doi = 10.1177/135965359900400204 | s2cid = 22443598 | doi-access = free }}), because in those trials loviride was often given alone and with no companion drug, leading to a high probability of developing reverse transcriptase mutations such as K103N which result in cross-class resistance to the NNRTIs efavirenz and nevirapine.