luseogliflozin

{{short description|Chemical compound}}

{{Infobox drug

| drug_name =

| INN =

| type =

| IUPAC_name =

| image = Luseogliflozin structure.svg

| width = 325

| alt =

| caption =

| pronounce =

| tradename = Lusefi

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_US =

| pregnancy_category=

| routes_of_administration =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_DE =

| legal_NZ =

| legal_UK =

| legal_US =

| legal_UN =

| legal_status = Rx-only in Japan

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 898537-18-3

| class =

| ATCvet =

| ATC_prefix = A10

| ATC_suffix = BK07

| PubChem = 11988953

| DrugBank = DB12214

| UNII = C596HWF74Z

| synonyms = TS-071

| C=23|H=30|O=6|S=1

| smiles = CCOC1=CC=C(C=C1)CC2=C(C=C(C(=C2)[C@H]3[C@@H]([C@H]([C@@H]([C@H](S3)CO)O)O)O)OC)C

}}

Luseogliflozin (trade name Lusefi) is a pharmaceutical drug (an SGLT2 inhibitor) used for the treatment of type 2 diabetes mellitus.{{cite journal | vauthors = Markham A, Elkinson S | s2cid = 1770988 | title = Luseogliflozin: first global approval | journal = Drugs | volume = 74 | issue = 8 | pages = 945–50 | date = June 2014 | pmid = 24848756 | doi = 10.1007/s40265-014-0230-8 }}{{cite journal | vauthors = Samukawa Y, Sata M, Furihata K, Ito T, Ueda N, Ochiai H, Sakai S, Kumagai Y | display-authors = 6 | title = Luseogliflozin, an SGLT2 Inhibitor, in Japanese Patients With Mild/Moderate Hepatic Impairment: A Pharmacokinetic Study | journal = Clinical Pharmacology in Drug Development | volume = 6 | issue = 5 | pages = 439–447 | date = September 2017 | pmid = 28783873 | doi = 10.1002/cpdd.364 | doi-access = free }} It was approved for use in Japan in 2014.

In a meta-analysis involving data from 10 randomized controlled trials (1304 patients), Dutta et. al. demonstrated the good glycaemic efficacy (mean glycated hemoglobin reduction of -0.76% and mean fasting glucose reduction of -26.69mg/dl) and safety of luseogliflozin 2.5mg/day as compared to placebo. Additional benefits include significant reduction in systolic blood pressure (-4.19 mm Hg), serum triglycerides (-12.60mg/dl), uric acid (-0.48mg/dl) and alanine aminotransferase (-4.11 IU/L) as compared to placebo, highlighting the beneficial impact on the different aspects of metabolic syndrome. {{cite journal | vauthors = Dutta D, Kadian J, Mahajan K, Dhall A, Sharma M | title = Efficacy and safety of luseogliflozin in improving glycaemic and non-glycaemic outcomes in type-2 diabetes: A meta-analysis. | journal = Diabetes Metab Syndr | volume = 17 | issue = 3 | date = Mar 2023 | pages = 102742 | pmid = 36933330 | doi = 10.1016/j.dsx.2023.102742 }}