lycopersene
{{Short description|Carotenoid}}
{{Chembox
| Name = Lycopersene
| ImageFile = Lycopersene.svg
| ImageSize = 250px
| ImageAlt =
| IUPACName = (6E,10E,14E,18E,22E,26E)-2,6,10,14,19,23,27,31-Octamethyldotriaconta-2,6,10,14,18,22,26,30-octaene
| OtherNames = Lycopaoctaene
| Section1 = {{Chembox Identifiers
| CASNo = 502-62-5
| ChEBI = 142538
| KEGG = C22055
| PubChem = 5365816
| StdInChI=1S/C40H66/c1-33(2)19-13-23-37(7)27-17-31-39(9)29-15-25-35(5)21-11-12-22-36(6)26-16-30-40(10)32-18-28-38(8)24-14-20-34(3)4/h19-22,27-30H,11-18,23-26,31-32H2,1-10H3/b35-21+,36-22+,37-27+,38-28+,39-29+,40-30+
| StdInChIKey = BGVXBZXEFXMRGJ-DPOFWPLISA-N
| SMILES = CC(=CCC/C(=C/CC/C(=C/CC/C(=C/CC/C=C(/CC/C=C(/CC/C=C(/CCC=C(C)C)\C)\C)\C)/C)/C)/C)C
| ChemSpiderID = 4517760
}}
| Section2 = {{Chembox Properties
| C = 40 | H = 66
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Lycopersene is a carotenoid found in Corynebacterium, Lemna minor, and Zea mays. It has the chemical formula of C40H66.{{cite web |title=Lycopersene |url=https://pubchem.ncbi.nlm.nih.gov/compound/Lycopersene |website=pubchem.ncbi.nlm.nih.gov |access-date=10 March 2023 |language=en}} It has antioxidant, antimutagenic, antiproliferative, cytotoxicity, antibacterial and pesticide effects.{{cite journal|last1=Arumugam |first1=Sathishkumar |last2=Ramessh |first2=Chelvi |last3=Kaliappan |first3=Gobala Krishnana |last4=Govindhan |first4=Rajiv |last5=Prakasam |first5=Sebastein Belciya |last6=Murugan |first6=Silambarasan |last7=Pandian |first7=Sureshkumar |last8=Asgar |first8=Ebadollahi |last9=Ravi |first9=Prasanth |title=Lycopersene: A review on extraction, identification and purification and applications |journal=Chemical Biology & Drug Design|date=January 2023|volume=101|number=1|url=https://pubmed.ncbi.nlm.nih.gov/36377692/ |access-date=10 March 2023 |pages=158–174 |doi=10.1111/cbdd.14158|pmid=36377692 |s2cid=253522324 }}