lycopersene

{{Short description|Carotenoid}}

{{Chembox

| Name = Lycopersene

| ImageFile = Lycopersene.svg

| ImageSize = 250px

| ImageAlt =

| IUPACName = (6E,10E,14E,18E,22E,26E)-2,6,10,14,19,23,27,31-Octamethyldotriaconta-2,6,10,14,18,22,26,30-octaene

| OtherNames = Lycopaoctaene

| Section1 = {{Chembox Identifiers

| CASNo = 502-62-5

| ChEBI = 142538

| KEGG = C22055

| PubChem = 5365816

| StdInChI=1S/C40H66/c1-33(2)19-13-23-37(7)27-17-31-39(9)29-15-25-35(5)21-11-12-22-36(6)26-16-30-40(10)32-18-28-38(8)24-14-20-34(3)4/h19-22,27-30H,11-18,23-26,31-32H2,1-10H3/b35-21+,36-22+,37-27+,38-28+,39-29+,40-30+

| StdInChIKey = BGVXBZXEFXMRGJ-DPOFWPLISA-N

| SMILES = CC(=CCC/C(=C/CC/C(=C/CC/C(=C/CC/C=C(/CC/C=C(/CC/C=C(/CCC=C(C)C)\C)\C)\C)/C)/C)/C)C

| ChemSpiderID = 4517760

}}

| Section2 = {{Chembox Properties

| C = 40 | H = 66

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Lycopersene is a carotenoid found in Corynebacterium, Lemna minor, and Zea mays. It has the chemical formula of C₄₀H_66.{{cite web |title=Lycopersene |url=https://pubchem.ncbi.nlm.nih.gov/compound/Lycopersene |website=pubchem.ncbi.nlm.nih.gov |access-date=10 March 2023 |language=en}} It has antioxidant, antimutagenic, antiproliferative, cytotoxicity, antibacterial and pesticide effects.{{cite journal|last1=Arumugam |first1=Sathishkumar |last2=Ramessh |first2=Chelvi |last3=Kaliappan |first3=Gobala Krishnana |last4=Govindhan |first4=Rajiv |last5=Prakasam |first5=Sebastein Belciya |last6=Murugan |first6=Silambarasan |last7=Pandian |first7=Sureshkumar |last8=Asgar |first8=Ebadollahi |last9=Ravi |first9=Prasanth |title=Lycopersene: A review on extraction, identification and purification and applications |journal=Chemical Biology & Drug Design|date=January 2023|volume=101|number=1|url=https://pubmed.ncbi.nlm.nih.gov/36377692/ |access-date=10 March 2023 |pages=158–174 |doi=10.1111/cbdd.14158|pmid=36377692 |s2cid=253522324 }}