lyxose

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 400114624

| ImageFile = Lyxose.png

| ImageSize = 180px

| ImageFile1 = Alpha-D-Lyxopyranose.svg

| ImageSize1 = 150px

| IUPACName = Lyxose

lyxo-Pentosehttps://iupac.qmul.ac.uk/2carb/app.html

| SystematicName = (2R,3R,4S)-2,3,4,5-Tetrahydroxypentanal

| OtherNames = L-Lyxose
Lyxopyranose

| Section1 = {{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=1949-78-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = M7J5HM9DY4

| PubChem=65550

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1159661

| ChEBI = 28480

| EINECS = 217-763-2

| ChemSpiderID = 559211

| SMILES=C([C@@H]([C@H]([C@H](C=O)O)O)O)O

| StdInChI = 1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2/t3-,4-,5-/m0/s1

| StdInChIKey = PYMYPHUHKUWMLA-YUPRTTJUSA-N

}}

| Section2 = {{Chembox Properties

| C = 5 | H = 10 | O = 5

| Appearance=

| Density= 1.545 g cm⁻³

| MeltingPtC= 108

| BoilingPt=

| Solubility= Soluble in water

}}

| Section3 = {{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Lyxose is an aldopentose — a monosaccharide containing five carbon atoms, and including an aldehyde functional group. It has chemical formula {{chem2|auto=1|C5H10O5}}. It is a C'-2 carbon epimer of the sugar xylose. The name "lyxose" comes from reversing the prefix "xyl" in "xylose".

Lyxose occurs only rarely in nature, for example, as a component of bacterial glycolipids.{{cite journal|first=K. H.|last=Khoo|first3=Russell|last3=Suzuki|first2=Anne|last2=Dell|first4=Howard R.|last4=Morris|first5=Michael R.|last5=McNeil|first6=Patrick J.|last6=Brennan|first7=Gurdyal S.|last7=Besra|url=https://pubs.acs.org/doi/10.1021/bi961055%2B|title=Chemistry of the Lyxose-Containing Mycobacteriophage Receptors of Mycobacterium phlei/Mycobacterium smegmatis|publisher=American Chemical Society|journal=Biochemistry|volume=35|doi=10.1021/bi961055+|issue=36|pages=11812-11819|date=10 September 1996|url-access=subscription}}

File:D-Lyxose Haworth.svg and pyranose forms]]

{{Clear left}}