maduramicin
{{Short description|Chemical compound}}
{{Infobox drug
| drug_name =
| IUPAC_name =
| image = Maduramicin.svg
| alt =
| caption =
| tradename =
| Drugs.com = {{drugs.com|international|maduramicin}}
| MedlinePlus =
| pregnancy_AU =
| pregnancy_category=
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| index2_label = acid
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 84878-61-5
| CAS_number2_Ref = {{cascite|correct|CAS}}
| CAS_number2 = 79356-08-4
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 5U912U22T2
| UNII2_Ref = {{fdacite|correct|FDA}}
| UNII2 = 6S6GVE3CIQ
| ATCvet = yes
| ATC_prefix = P51
| ATC_suffix = BB05
| PubChem = 68595
| DrugBank =
| ChEMBL = 1909066
| ChemSpiderID = 61862
| synonyms = Maduramycin
| C=47 | H=80 | O=17
| smiles= O=C(O)C[C@@]1(O)O[C@H]([C@H](OC)[C@@H](OC)[C@@H]1C)[C@H](C)[C@H]7O[C@]6(O[C@](C)([C@@H]5O[C@](C)([C@@H]4O[C@@H]([C@H]2O[C@@](O)(C)[C@H](C)C[C@@H]2C)C[C@@H]4O[C@H]3O[C@@H](C)[C@H](OC)[C@@H](OC)C3)CC5)CC6)C[C@H](O)[C@H]7C
}}
Maduramicin (maduramycin) is an antiprotozoal agent used in veterinary medicine to prevent coccidiosis.[http://www.inspection.gc.ca/animals/feeds/medicating-ingredients/mib/mib-71/eng/1331067351687/1331067403200 Maduramicin Ammonium], Canadian Food Inspection Agency{{cite journal | vauthors = McDougald LR, Fuller AL, Mathis GF, Wang GT | title = Efficacy of maduramicin ammonium against coccidiosis in turkeys under laboratory and floor-pen conditions | journal = Avian Diseases | volume = 34 | issue = 3 | pages = 634–638 | year = 1990 | pmid = 2241692 | doi = 10.2307/1591256 | jstor = 1591256 }} It is a natural chemical compound first isolated from the actinomycete Actinomadura rubra.{{cite journal | vauthors = Fleck WF, Strauss DG, Meyer J, Porstendorfer G | title = Fermentation, isolation, and biological activity of maduramycin: a new antibiotic from Actinomadura rubra | journal = Zeitschrift für Allgemeine Mikrobiologie | volume = 18 | issue = 6 | pages = 389–398 | year = 1978 | pmid = 362738 | doi = 10.1002/jobm.3630180602 | doi-broken-date = 17 March 2025 }}
References
{{reflist}}
{{Antiinfective-drug-stub}}