magnesium diglutamate

{{chembox

| Watchedfields = changed

| verifiedrevid = 419351750

| Reference =[https://www.sigmaaldrich.com/US/en/product/aldrich/49605 L-Glutamic acid hemimagnesium salt tetrahydrate] at Sigma-Aldrich

| ImageFile =Magnesium diglutamate.png

| ImageSize =

| IUPACName = Magnesium diglutamate(1−)

| SystematicName = Magnesium bis(4-amino-4-carboxybutanoate)

| OtherNames = {{Unbulleted list|Magnesium glutamate|E625|Glutamic acid hemimagnesium salt}}

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 3306947

| InChI = 1/2C5H9NO4.Mg/c2*6-3(5(9)10)1-2-4(7)8;/h2*3H,1-2,6H2,(H,7,8)(H,9,10);/q;;+2/p-2

| InChIKey = MYUGVHJLXONYNC-NUQVWONBAS

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/2C5H9NO4.Mg/c2*6-3(5(9)10)1-2-4(7)8;/h2*3H,1-2,6H2,(H,7,8)(H,9,10);/q;;+2/p-2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = MYUGVHJLXONYNC-UHFFFAOYSA-L

| CASNo_Ref = {{cascite|correct|??}}

| CASNo =18543-68-5

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = U515Z7SI3O

| PubChem =4092622

| SMILES = [Mg+2].O=C([O-])CCC(N)C(=O)O.[O-]C(=O)CCC(N)C(=O)O

}}

|Section2={{Chembox Properties

| C=10 | H=16 | Mg=1 | N=2 | O=8

| Appearance =

| Density =

| MeltingPt= Tetrahydrate:

| MeltingPtC = 130 to 135

| MeltingPt_notes = (decomposes)

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Magnesium diglutamate is a compound with formula Mg(C₅H₈NO₄)₂. It is a magnesium acid salt of glutamic acid.

It has the E number E625 and is used in foods as a flavor enhancer.