magnesium orotate

{{Short description|Chemical compound}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 447933425

| IUPAC_name = magnesium 2,6-dioxo-3H-pyrimidine-4-carboxylate

| image = magnesium orotate.png

| tradename =

| Drugs.com = {{drugs.com|CDI|magnesium_orotate}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 34717-03-8

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = GI96W46M5A

| ATC_prefix = A12

| ATC_suffix = CC09

| PubChem = 3036905

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID = 2300801

| C=10 | H=6 | Mg=1 | N=4 | O=8

| smiles = [Mg+2].O=C([O-])\C1=C\C(=O)NC(=O)N1.[O-]C(=O)\C1=C\C(=O)NC(=O)N1

| StdInChI = 1S/2C5H4N2O4.Mg/c2*8-3-1-2(4(9)10)6-5(11)7-3;/h2*1H,(H,9,10)(H2,6,7,8,11);/q;;+2/p-2

| StdInChIKey = QWLHYYKDLOVBNV-UHFFFAOYSA-L

}}

Magnesium orotate, the magnesium salt of orotic acid, is a mineral supplement. It can be used in treating extracellular magnesium deficiency, as well as in mitigating magnesium depletion that inhibits the binding of adenosine triphosphate via orotic acid, which provides binding sites.{{cite journal | vauthors = Classen HG | title = Magnesium orotate--experimental and clinical evidence | journal = Romanian Journal of Internal Medicine | volume = 42 | issue = 3 | pages = 491–501 | date = 2004 | pmid = 16366126 }}

References

{{reflist}}

{{Mineral supplements}}

{{DEFAULTSORT:Magnesium Orotate}}

Category:Magnesium compounds

{{gastrointestinal-drug-stub}}