mangafodipir
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 462099595
| IUPAC_name =
| image = Mangafodipir 3D sticks.png
| image2 = Mangafodipir.svg
| tradename =
| Drugs.com = {{drugs.com|CONS|mangafodipir}}
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category = Not to be used
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration = Intravenous infusion
| bioavailability = NA
| protein_bound = 27% (manganese)
Negligible (DPDP)
| metabolism =
| elimination_half-life = 20 minutes (manganese)
50 minutes (DPDP)
| excretion = Renal and fecal (manganese)
Renal (DPDP)
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 155319-91-8
| ATC_prefix = V08
| ATC_suffix = CA05
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = N02W67RKJS
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1628235
| PubChem = 76967443
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 4885577
| C=22 | H=28 | Mn=1 | N=4 | O=14 | P=2
| smiles = O=P(O)(O)OCc0cnc(C)c([O+H][Mn-4]12345)c0C[N+]1(CC(=O)O2)CC[N+]3(CC(=O)O4)Cc0c([O+H]5)c(C)ncc0COP(O)(O)=O
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C22H32N4O14P2.Mn/c1-13-21(31)17(15(5-23-13)11-39-41(33,34)35)7-25(9-19(27)28)3-4-26(10-20(29)30)8-18-16(12-40-42(36,37)38)6-24-14(2)22(18)32;/h5-6,31-32H,3-4,7-12H2,1-2H3,(H,27,28)(H,29,30)(H2,33,34,35)(H2,36,37,38);/q;+2/p-2
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = QDQFSBKXQQZVTB-UHFFFAOYSA-L
}}
Mangafodipir (sold under the brand name Teslascan as mangafodipir trisodium) is a contrast agent delivered intravenously to enhance contrast in magnetic resonance imaging (MRI) of the liver, and has potential to serve as an adjunct for various chemotherapeutic agents and during coronary intervention. It has two parts, a paramagnetic manganese(II) ion and the fodipir (dipyridoxyl diphosphate, DPDP) chelating agent. When freed from the organic ligand, the manganese shortens the longitudinal relaxation time (T1) in an MRI scan. Normal liver tissue absorbs the manganese more than abnormal or cancerous tissue, which makes the normal tissue appear brighter in MRIs. This enhanced contrast allows lesions to be more easily identified.
Mangafodipir was withdrawn from the US market in 2003{{cite web|title=January 2005: Additions and Deletions to the Drug Product List|url=https://www.fda.gov/drugs/informationondrugs/ucm091413.htm|website=U.S. Food and Drug Administration}} and the European market in 2012 for commercial reasons by the manufacturer.{{cite web|title=Teslascan (mangafodipir): Withdrawal of the marketing authorisation in the European Union|url=http://www.ema.europa.eu/docs/en_GB/document_library/Public_statement/2012/08/WC500130495.pdf|website=European Medicines Agency}}
Reactive oxygen species (ROS) and reactive nitrogen species (RNS) participate in pathological tissue damage. Mitochondrial manganese superoxide dismutase (MnSOD) normally keeps ROS and RNS in check. During development of mangafodipir as an MRI contrast agent, it was discovered that it possessed MnSOD mimetic activity. Mangafodipir has been tested as a chemotherapy adjunct in cancer patients and as an adjunct to percutaneous coronary intervention in patients with myocardial infarctions, with promising results.{{cite journal | vauthors = Karlsson JO, Ignarro LJ, Lundström I, Jynge P, Almén T | title = Calmangafodipir [Ca4Mn(DPDP)5], mangafodipir (MnDPDP) and MnPLED with special reference to their SOD mimetic and therapeutic properties | journal = Drug Discovery Today | volume = 20 | issue = 4 | pages = 411–421 | date = April 2015 | pmid = 25463039 | doi = 10.1016/j.drudis.2014.11.008 | doi-access = free }}
Mangafodipir has shown promising results in human brain imaging without detectable toxicity{{cite journal | vauthors = Sudarshana DM, Nair G, Dwyer JT, Dewey B, Steele SU, Suto DJ, Wu T, Berkowitz BA, Koretsky AP, Cortese IC, Reich DS | display-authors = 6 | title = Manganese-Enhanced MRI of the Brain in Healthy Volunteers | journal = AJNR. American Journal of Neuroradiology | volume = 40 | issue = 8 | pages = 1309–1316 | date = August 2019 | pmid = 31371354 | pmc = 6754109 | doi = 10.3174/ajnr.A6152 }}{{ClinicalTrialsGov|NCT01326715|Manganese-Enhanced Magnetic Resonance Imaging in Healthy Volunteers and People With Multiple Sclerosis}}. and usefulness in detecting lesions in multiple sclerosis.{{cite journal | vauthors = Suto DJ, Nair G, Sudarshana DM, Steele SU, Dwyer J, Beck ES, Ohayon J, McFarland H, Koretsky AP, Cortese IC, Reich DS | display-authors = 6 | title = Manganese-Enhanced MRI in Patients with Multiple Sclerosis | journal = AJNR. American Journal of Neuroradiology | volume = 41 | issue = 9 | pages = 1569–1576 | date = September 2020 | pmid = 32763897 | pmc = 7583091 | doi = 10.3174/ajnr.A6665 }}
Whereas MRI contrast depends on release of Mn2+, the MnSOD mimetic activity depends on Mn2+ that remains bound to DPDP. Calmangafodipir [Ca4Mn(DPDP)5] (brand name PledOx) is stabilized with respect to Mn2+ and has improved therapeutic activity. Calmangafodipir is being explored as a chemotherapy adjunct in cancer patients.
References
{{reflist}}
External links
- [http://www.teslascan.com Teslascan.com]
- [https://www.nlm.nih.gov/medlineplus/druginfo/uspdi/203456.html MedlinePlus data sheet]
- [https://web.archive.org/web/20130207171502/http://www.medsafe.govt.nz/Profs/Datasheet/t/Teslascaninj.htm Medsafe data sheet]
{{Contrast media}}