manidipine

{{Short description|Antihypertensive drug of the calcium channel blocker class}}

{{cs1 config|name-list-style=vanc}}

{{Drugbox

| IUPAC_name = (±)-2-[4-(Diphenylmethyl)piperazin-1-yl]ethyl methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate

| image = Manidipine.svg

| width = 250px

| tradename = Manyper, Caldine, etc.

| Drugs.com = {{drugs.com|international|manidipine}}

| pregnancy_category =

| legal_status = Rx-only

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 89226-50-6

| CAS_supplemental = {{CAS|120092-68-4}}

| ATC_prefix = C08

| ATC_suffix = CA11

| PubChem = 4008

| DrugBank =

| ChemSpiderID = 3868

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 6O4754US88

| C=35 | H=38 | N=4 | O=6

| smiles = [O-][N+](=O)c1cccc(c1)C5C(/C(=O)OC)=C(\N\C(=C5\C(=O)OCCN4CCN(C(c2ccccc2)c3ccccc3)CC4)C)C

| StdInChI = 1S/C35H38N4O6/c1-24-30(34(40)44-3)32(28-15-10-16-29(23-28)39(42)43)31(25(2)36-24)35(41)45-22-21-37-17-19-38(20-18-37)33(26-11-6-4-7-12-26)27-13-8-5-9-14-27/h4-16,23,32-33,36H,17-22H2,1-3H3

}}

Manidipine is a calcium channel blocker (dihydropyridine type) that is used clinically as an antihypertensive.

{{cite journal | vauthors = Cheer SM, McClellan K | title = Manidipine: a review of its use in hypertension | journal = Drugs | volume = 61 | issue = 12 | pages = 1777–1799 | year = 2001 | pmid = 11693466 | doi = 10.2165/00003495-200161120-00010 | s2cid = 260814599 | url = http://drugs.adisonline.com/pt/re/drugs/abstract.00003495-200161120-00010.htm | url-status = dead | access-date = 2009-06-20 | archive-url = https://archive.today/20130117062428/http://drugs.adisonline.com/pt/re/drugs/abstract.00003495-200161120-00010.htm | archive-date = 2013-01-17 | url-access = subscription }}

{{cite journal | vauthors = McKeage K, Scott LJ | title = Manidipine: a review of its use in the management of hypertension | journal = Drugs | volume = 64 | issue = 17 | pages = 1923–1940 | year = 2004 | pmid = 15329044 | doi = 10.2165/00003495-200464170-00011 | s2cid = 195689527 | url = http://drugs.adisonline.com/pt/re/drugs/abstract.00003495-200464170-00011.htm | url-status = dead | access-date = 2009-06-20 | archive-url = https://archive.today/20130116081831/http://drugs.adisonline.com/pt/re/drugs/abstract.00003495-200464170-00011.htm | archive-date = 2013-01-16 | url-access = subscription }}

{{cite journal | vauthors = Roca-Cusachs A, Triposkiadis F | title = Antihypertensive effect of manidipine | journal = Drugs | volume = 65 | pages = 11–19 | year = 2005 | issue = Suppl 2 | pmid = 16398058 | doi = 10.2165/00003495-200565002-00003 | url = http://drugs.adisonline.com/pt/re/drugs/abstract.00003495-200565002-00003.htm | url-status = dead | access-date = 2009-06-20 | s2cid = 25854593 | archive-url = https://archive.today/20130116050439/http://drugs.adisonline.com/pt/re/drugs/abstract.00003495-200565002-00003.htm | archive-date = 2013-01-16 | url-access = subscription }}

{{cite journal | vauthors = Otero ML | title = Manidipine-delapril combination in the management of hypertension | journal = Vascular Health and Risk Management | volume = 3 | issue = 3 | pages = 255–263 | year = 2007 | pmid = 17703633 | pmc = 2293964 }}{{cite journal | vauthors = Mizuno K, Haga H, Takahashi M, Fukuchi S | doi = 10.1016/S0011-393X(05)80475-8 | volume = 52 | issue = 2 | pages = 248–253 | title = Evaluation of manidipine hydrochloride, a new calcium antagonist, in the treatment of hypertensive patients with renal disorders | journal = Current Therapeutic Research | date = August 1992 }}

It was patented in 1982 and approved for medical use in 1990.{{cite book | vauthors = Fischer J, Ganellin CR |title=Analogue-based Drug Discovery |date=2006 |publisher=John Wiley & Sons |isbn=9783527607495 |page=465 |url=https://books.google.com/books?id=FjKfqkaKkAAC&pg=PA465 |language=en}}