mariptiline

{{Short description|Tricyclic antidepressant developed in the 1980s}}

{{Drugbox

| IUPAC_name = 1a,10b-dihydrodibenzo[a,e]cyclopropa[c]cyclohepten-6(1H)-one O-(2-aminoethyl)oxime

| image = Mariptiline.png

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 60070-14-6

| ATC_prefix = none

| ATC_suffix =

| PubChem = 44203

| ChemSpiderID = 40222

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = E27T357050

| C=18 | H=18 | N=2 | O=1

| smiles = O(\N=C2/c1c(cccc1)C4CC4c3c2cccc3)CCN

}}

Mariptiline (EN-207) is a tricyclic antidepressant (TCA) which was developed in the early 1980s, but was never marketed.{{cite book | vauthors = Triggle DJ | title = Dictionary of pharmacological agents | publisher = Chapman & Hall | location = London | year = 1997 | isbn = 0-412-46630-9 | url = https://books.google.com/books?id=A0THacd46ZsC&q=mariptiline&pg=PA1254}}{{cite book | vauthors = Hess HJ | title = Annual Reports in Medicinal Chemistry Volume 17 | publisher = Academic Press | location = Boston | year = 1982 | pages = 400 | isbn = 0-12-040517-2 | url = https://books.google.com/books?id=gprdTFMiho4C&q=mariptiline&pg=PA41}}