mavacoxib
{{Short description|Veterinary drug}}
{{Use dmy dates|date=June 2024}}
{{cs1 config |name-list-style=vanc |display-authors=6}}
{{Drugbox
| IUPAC_name =
| image = Mavacoxib.svg
| image_class = skin-invert-image
| alt =
| caption =
| tradename = Trocoxil
| Drugs.com = {{drugs.com|international|mavacoxib}}
| MedlinePlus =
| pregnancy_AU =
| pregnancy_category=
| routes_of_administration =
| ATC_prefix = M01
| ATC_suffix = AH92
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_EU = Rx-only
| legal_status =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 170569-88-7
| ATCvet = yes
| UNII = YFT7X7SR77
| PubChem = 9843089
| DrugBank =
| ChemSpiderID = 8018804
| ChEBI = 76207
| C=16 | H=11 |F=4 | N=3 | O=2 | S=1
| smiles = C1=CC(=CC=C1C2=CC(=NN2C3=CC=C(C=C3)S(=O)(=O)N)C(F)(F)F)F
| StdInChI = 1S/C16H11F4N3O2S/c17-11-3-1-10(2-4-11)14-9-15(16(18,19)20)22-23(14)12-5-7-13(8-6-12)26(21,24)25/h1-9H,(H2,21,24,25)
| StdInChIKey = TTZNQDOUNXBMJV-UHFFFAOYSA-N
}}
Mavacoxib (trade name Trocoxil) is a veterinary drug used to treat pain and inflammation in dogs with degenerative joint
disease.[http://www.ema.europa.eu/docs/en_GB/document_library/EPAR_-_Summary_for_the_public/veterinary/000132/WC500069275.pdf European Public Assessment Report (EPAR): Trocoxil] {{Webarchive|url=https://web.archive.org/web/20180317151704/http://www.ema.europa.eu/docs/en_GB/document_library/EPAR_-_Summary_for_the_public/veterinary/000132/WC500069275.pdf |date=17 March 2018 }}, European Medicines Agency It acts as a COX-2 inhibitor.{{cite journal | vauthors = Cox SR, Lesman SP, Boucher JF, Krautmann MJ, Hummel BD, Savides M, Marsh S, Fielder A, Stegemann MR | display-authors = 6 | title = The pharmacokinetics of mavacoxib, a long-acting COX-2 inhibitor, in young adult laboratory dogs | journal = Journal of Veterinary Pharmacology and Therapeutics | volume = 33 | issue = 5 | pages = 461–70 | date = October 2010 | pmid = 20840390 | doi = 10.1111/j.1365-2885.2010.01165.x }}
Mavacoxib, along with several other COX-2 selective inhibitors, including celecoxib, valdecoxib, and parecoxib, were discovered by a team at the Searle division of Monsanto led by John Talley.{{cite news |last1=Langreth |first1=Robert | name-list-style = vanc |title=The Chemical Cobbler |url= https://www.forbes.com/global/2003/0623/050.html |work=Forbes |date=June 23, 2003 }}{{cite journal|title=Dr. John Talley: 2001 St. Louis Awardee|journal=Chemical Bond|date=May 2001|volume=52|issue=5|page=2|url=http://www.stlacs.org/Bonds/2001May.pdf|publisher=St. Louis Section, American Chemical Society|archive-url=https://web.archive.org/web/20180415180802/http://www.stlacs.org/Bonds/2001May.pdf|archive-date=15 April 2018}}
References
{{Reflist}}
{{NSAIDs}}
{{Prostanoidergics}}
{{Portal bar | Medicine}}
{{Authority control}}
Category:Nonsteroidal anti-inflammatory drugs
Category:4-Fluorophenyl compounds
Category:Trifluoromethyl compounds
{{veterinary-med-stub}}
{{musculoskeletal-drug-stub}}