maximiscin

{{Chembox

| Name =

| ImageFile = (–)-maximiscin.svg

| ImageSize = 200px

| ImageAlt =

| PIN = Methyl (3R,4R,5R,6R)-6-({3-[(1R,2S,4R,6S)-2-ethenyl-4,6-dimethylcyclohexyl]-4-hydroxy-2-oxopyridin-1(2H)-yl}oxy)-3,4,5-trihydroxycyclohex-1-ene-1-carboxylate

| OtherNames =

| SystematicName =

| Section1 = {{Chembox Identifiers

| CASNo = 1612154-44-5

| PubChem = 132521702

| ChEMBL = 3903473

| SMILES = COC(=O)C1=C[C@H](O)[C@H](O)[C@H](O)[C@@H]1ON1C=CC(O)=C([C@@H]2[C@@H](C)C[C@@H](C)C[C@H]2C=C)C1=O

| InChI= 1S/C23H31NO8/c1-5-13-9-11(2)8-12(3)17(13)18-15(25)6-7-24(22(18)29)32-21-14(23(30)31-4)10-16(26)19(27)20(21)28/h5-7,10-13,16-17,19-21,25-28H,1,8-9H2,2-4H3/t11-,12+,13-,16+,17-,19+,20+,21-/m1/s1

| InChIKey = BHUFOFQGYXAGAC-XMGLCDBZSA-N

| ChemSpiderID = 34485502

}}

| Section2 = {{Chembox Properties

| C=23 | H=31 | N=1 | O=8

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

| Section4 =

| Section5 =

| Section6 =

}}

Maximiscin is a polyketide-shikimate chemical compound isolated from Tolypocladium that shows tumor growth suppression in an animal model.{{Cite journal | doi = 10.1055/s-0033-1348528 | title = Maximiscin, a Novel Shikimate-Polyketide-NRPS Hybrid Metabolite Obtained from Tolypocladium Sp. With Potent Antitumor Activities | year = 2013 | last1 = Du | first1 = L | last2 = Robles | first2 = AJ | last3 = King | first3 = JB | last4 = Powell | first4 = DR | last5 = Miller | first5 = AN | last6 = Mooberry | first6 = SL | last7 = Cichewicz | first7 = RH | journal = Planta Medica | volume = 79 | issue = 10}} The discovery of maximiscin was the result of a citizen scientist crowdsourcing project by the University of Oklahoma.{{cite journal | pmid = 24285637 | year = 2013 | last1 = Du | first1 = L | last2 = Robles | first2 = AJ | last3 = King | first3 = JB | last4 = Powell | first4 = DR | last5 = Miller | first5 = AN | last6 = Mooberry | first6 = SL | last7 = Cichewicz | first7 = RH | title = Crowdsourcing Natural Products Discovery to Access Uncharted Dimensions of Fungal Metabolite Diversity | doi = 10.1002/anie.201306549 | journal = Angewandte Chemie International Edition in English | pages = 804–9| volume=53 | issue=3 | pmc=4028707}} The soil sample which yielded maximiscin was sent by a woman from Salcha, Alaska.{{cite web | url = http://www.rsc.org/chemistryworld/2013/12/crowdsourcing-delivers-promising-anticancer-fungi-compound | title = Crowdsourcing unearths promising anticancer compound | author = Julianne Wyrick | date = December 5, 2013 | website = chemistryworld.com | publisher = Royal Society of Chemistry}}