mephenoxalone

{{Short description|Muscle relaxant}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 447821122

| IUPAC_name = 5-[(2-methoxyphenoxy)methyl]-1,3-oxazolidin-2-one

| image = Mephenoxalone.svg

| image_class = skin-invert-image

| tradename = Dorsiflex, Moderamin, Control-OM

| Drugs.com = {{drugs.com|international|mephenoxalone}}

| pregnancy_category =

| legal_AU =

| legal_BR = C1

| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-04-04}}

| legal_CA =

| legal_DE =

| legal_NZ =

| legal_UK =

| legal_US =

| legal_EU =

| legal_UN =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 70-07-5

| ATC_prefix = N05

| ATC_suffix = BX01

| PubChem = 6257

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2104790

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = CZ87T54W8W

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07318

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 6021

| C=11 | H=13 | N=1 | O=4

| smiles = O=C2OC(COc1c(OC)cccc1)CN2

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C11H13NO4/c1-14-9-4-2-3-5-10(9)15-7-8-6-12-11(13)16-8/h2-5,8H,6-7H2,1H3,(H,12,13)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = ZMNSRFNUONFLSP-UHFFFAOYSA-N

}}

Mephenoxalone (trade names Dorsiflex, Moderamin, Control-OM) is a muscle relaxant{{cite journal | vauthors = Magnenat M | title = [The utilization in psychotherapy of a tensiolytic agent with muscle relaxant effect, Control OM (mephenoxalone), alone or associated with thymoleptics] | journal = Therapeutische Umschau. Revue Therapeutique | volume = 18 | pages = 516–20 | date = December 1961 | pmid = 14468333 }} and mild anxiolytic.MIMS: [http://www.mims.com/USA/drug/info/mephenoxalone/ Mephenoxalone] It inhibits neuron transmission, relaxing skeletal muscles by inhibiting the reflex arc.{{citation needed|date=December 2013}} As the effect of muscle relaxation, mephenoxalone affects mental condition, and is also a treatment for nervousness and anxiety.