mepixanox

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 444473613

| IUPAC_name = 3-Methoxy-4-(piperidin-1-ylmethyl)-9H-xanthen-9-one

| image = Mepixanox.svg

| width = 200

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 17854-59-0

| ATC_prefix = R07

| ATC_suffix = AB09

| PubChem = 65687

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2104462

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 59116

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7419T4YQQW

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07410

| C=20 | H=21 | N=1 | O=3

| smiles = COC1=C(C2=C(C=C1)C(=O)C3=CC=CC=C3O2)CN4CCCCC4

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI=1S/C20H21NO3/c1-23-17-10-9-15-19(22)14-7-3-4-8-18(14)24-20(15)16(17)13-21-11-5-2-6-12-21/h3-4,7-10H,2,5-6,11-13H2,1H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = PYSOHOOUXFWCFF-UHFFFAOYSA-N

}}

Mepixanox (Pimexone) is a respiratory stimulant.{{Cite book | doi = 10.1016/S0065-7743(08)61058-1 | title = Chapter 32. To Market, to Market—1984 | volume = 20 | pages = [https://archive.org/details/annualreportsinm0000unse_i5v6/page/315 315–325] | series = Annual Reports in Medicinal Chemistry | year = 1985 | vauthors = Allen RC | isbn = 9780120405206 | url = https://archive.org/details/annualreportsinm0000unse_i5v6/page/315 }}