meprotixol

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 447812217

| IUPAC_name = 9-(3-Dimethylaminopropyl)-2-methoxy-9H-thioxanthen-9-ol

| image = Meprotixol.png

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 4295-63-0

| ATC_prefix = R05

| ATC_suffix = DB22

| PubChem = 71195

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 64331

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 2JXZ154Z0Q

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07394

| C=19 | H=23 | N=1 | O=2 | S=1

| smiles = O(c3cc2c(Sc1ccccc1C2(O)CCCN(C)C)cc3)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C19H23NO2S/c1-20(2)12-6-11-19(21)15-7-4-5-8-17(15)23-18-10-9-14(22-3)13-16(18)19/h4-5,7-10,13,21H,6,11-12H2,1-3H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = LAYVFLWAVIGDLK-UHFFFAOYSA-N

}}

Meprotixol is a cough suppressant.{{cite journal | vauthors = Hougs W, Nielsen IM, Norn S, Nymark M | title = Pharmacology of a new antitussive agent: meprotixol (N 7020) | journal = Acta Pharmacologica et Toxicologica | volume = 24 | issue = 1 | pages = 3–23 | year = 1966 | pmid = 6012748 | doi = 10.1111/j.1600-0773.1966.tb00364.x }} It has also been used for the treatment of rheumatic diseases.{{cite journal | vauthors = Kogstad O | title = [Meprotixol (N 7020). Clinical experiences in rheumatic diseases] | journal = Tidsskrift for den Norske Laegeforening | volume = 94 | issue = 4 | pages = 212–4 | date = February 1974 | pmid = 4595469 }}

References