mercury(II) nitrate

{{chembox

|Verifiedfields = changed

|Watchedfields = changed

|verifiedrevid = 441024345

|Name = Mercury(II) nitrate

|ImageFile = mercury nitrate.png

|ImageSize = 150px

|ImageFile2 =Mercury_nitrate_II,_hydrate.jpg

|ImageSize2 = 200px

|IUPACName = Mercury dinitrate
Mercury(II) nitrate

|OtherNames = Mercuric nitrate

|Section1={{Chembox Identifiers

|CASNo_Ref = {{cascite|correct|CAS}}

|CASNo = 10045-94-0

|CASNo2_Ref = {{cascite|changed|??}}

|CASNo2 = 7783-34-8

|CASNo2_Comment = (monohydrate)

|UNII_Ref = {{fdacite|changed|FDA}}

|UNII = 2FMV9338BW

|EINECS = 233-152-3

|UNNumber = 1625

|RTECS = OW8225000

|PubChem = 16683796

|ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

|ChemSpiderID = 23247

|SMILES = [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Hg+2]

|InChI = 1/Hg.2NO3/c;2*2-1(3)4/q+2;2*-1

|InChIKey = ORMNPSYMZOGSSV-UHFFFAOYAS

|StdInChI_Ref = {{stdinchicite|changed|chemspider}}

|StdInChI = 1S/Hg.2NO3/c;2*2-1(3)4/q+2;2*-1

|StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

|StdInChIKey = ORMNPSYMZOGSSV-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

|Formula = {{chem2|Hg(NO3)2}}

|MolarMass = 324.60 g/mol (anhydrous)

|Appearance = colorless crystals or white powder

|Odor = sharp

|Density = 4.3 g/cm³ (monohydrate)

|Solubility = soluble

|SolubleOther = soluble in nitric acid, acetone, ammonia
insoluble in ethanol

|MeltingPtC = 79

|MeltingPt_notes = (monohydrate)

|MagSus = −74.0·10⁻⁶ cm³/mol

}}

|Section3={{Chembox Hazards

|ExternalSDS = [http://www.inchem.org/documents/icsc/icsc/eics0980.htm ICSC 0980]

|GHSPictograms= {{GHS03}}{{GHS06}}{{GHS08}}{{GHS09}}

|GHSSignalWord = Danger

|HPhrases = {{H-phrases|272|300|310|330|373|410}}

|PPhrases = {{P-phrases|}}

|NFPA-H = 3

|NFPA-F = 0

|NFPA-R = 1

|NFPA-S = OX

|FlashPt = Nonflammable

}}

|Section4={{Chembox Related

|OtherAnions = Mercury(II) sulfate
Mercury(II) chloride

|OtherCations = Zinc nitrate
Cadmium nitrate

|OtherCompounds = Mercury(I) nitrate

}}

}}

Mercury(II) nitrate is an inorganic compound with the chemical formula {{chem2|Hg(NO3)2|auto=1}}. It is the mercury(II) salt of nitric acid {{chem2|HNO3}}. It contains mercury(II) cations {{chem2|Hg(2+)}} and nitrate anions {{chem2|NO3−}}, and water of crystallization {{chem2|H2O}} in the case of a hydrous salt. Mercury(II) nitrate forms hydrates {{chem2|Hg(NO3)2*xH2O}}. Anhydrous and hydrous salts are colorless or white soluble crystalline solids that are occasionally used as a reagents. Mercury(II) nitrate is made by treating mercury with hot concentrated nitric acid. Neither anhydrous nor monohydrate has been confirmed by X-ray crystallography.{{Cite journal |last=Nolte |first=M. |last2=Pantenburg |first2=I. |last3=Meyer |first3=G. |date=9 December 2005 |title=The Monohydrate of Basic Mercuric Nitrate, [Hg(OH)](NO₃)(H₂O) |url=https://onlinelibrary.wiley.com/doi/10.1002/zaac.200500344 |journal=Zeitschrift für anorganische und allgemeine Chemie |language=de |publisher=Wiley Publishing |volume=632 |issue=1 |pages=111–113 |doi=10.1002/zaac.200500344 |issn=0044-2313 |access-date=16 May 2022 |archive-date=27 November 2021 |archive-url=https://web.archive.org/web/20211127161557/https://onlinelibrary.wiley.com/doi/10.1002/zaac.200500344 |url-status=live}} The anhydrous material is more widely used.{{cln|reason=The last two sentences contradict each other! Anhydrous form is not confirmed by the X-ray crystallography, but is used widely. What???|date=May 2024}}