mesulergine

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = SML95FK06I

| verifiedrevid = 462249130

| IUPAC_name = N'-(1,6-dimethylergolin-8α-yl)-N,N-dimethylsulfamide

| image = Mesulergine.svg

| index_label =

| index2_label = [3H]mesulergine

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C18H26N4O2S/c1-20(2)25(23,24)19-13-9-15-14-6-5-7-16-18(14)12(10-21(16)3)8-17(15)22(4)11-13/h5-7,10,13,15,17,19H,8-9,11H2,1-4H3/t13-,15+,17+/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = JLVHTNZNKOSCNB-YSVLISHTSA-N

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 64795-35-3

| ATC_prefix =

| ATC_suffix =

| PubChem = 68848

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 73378

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 462903

| IUPHAR_ligand2 = 232

| IUPHAR_ligand = 206

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 62081

| synonyms = CU-32085

| C=18 | H=26 | N=4 | O=2 | S=1

| smiles = O=S(=O)(N(C)C)N[C@H]2C[C@@H]3c4cccc1c4c(cn1C)C[C@H]3N(C2)C

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_category=

| legal_status =

| routes_of_administration =

}}

Mesulergine ({{Abbrlink|INN|International Nonproprietary Name}}) (developmental code name CU-32085) is a drug of the ergoline group which was never marketed.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA776|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=776–}}{{cite book| vauthors = Morton IK, Hall JM |title=Concise Dictionary of Pharmacological Agents: Properties and Synonyms|url=https://books.google.com/books?id=tsjrCAAAQBAJ&pg=PA177|date=6 December 2012|publisher=Springer Science & Business Media|isbn=978-94-011-4439-1|pages=177–}} It acts on serotonin and dopamine receptors.{{cite journal | vauthors = Closse A | title = [3H]Mesulergine, a selective ligand for serotonin-2 receptors | journal = Life Sciences | volume = 32 | issue = 21 | pages = 2485–2495 | date = May 1983 | pmid = 6855451 | doi = 10.1016/0024-3205(83)90375-2 }}{{cite journal | vauthors = Markstein R | title = Mesulergine and its 1,20-N,N-bidemethylated metabolite interact directly with D1- and D2-receptors | journal = European Journal of Pharmacology | volume = 95 | issue = 1–2 | pages = 101–107 | date = November 1983 | pmid = 6230246 | doi = 10.1016/0014-2999(83)90272-8 }} Specifically, it is an agonist of dopamine D2-like receptors and serotonin 5-HT6 receptors and an antagonist of serotonin 5-HT2A, 5-HT2B, 5-HT2C, and 5-HT7 receptors.{{Citation needed|date=April 2021}}. It also has affinity for the 5-HT1A, 5-HT1B, 5-HT1D, 5-HT1F, and 5-HT5A receptors.National Institute of Mental Health. PDSD Ki Database (Internet). ChapelHill (NC): University of North Carolina. Available from: {{cite web|url=http://pdsp.med.unc.edu/pdsp.php|title=PDSP Database - UNC |access-date=|url-status=|archive-url=https://web.archive.org/web/20210412230434/https://pdsp.unc.edu/databases/pdsp.php?receptorDD=&receptor=&speciesDD=&species=&sourcesDD=&source=&hotLigandDD=&hotLigand=&testLigandDD=&testFreeRadio=testFreeRadio&testLigand=Mesulergine&referenceDD=&reference=&KiGreater=&KiLess=&kiAllRadio=all&doQuery=Submit+Query |archive-date=12 April 2021}} The compound had entered clinical trials for the treatment of Parkinson's disease; however, further development was halted due to adverse histological abnormalities in rats.{{cite journal | vauthors = Dupont E, Mikkelsen B, Jakobsen J | title = Mesulergine in early Parkinson's disease: a double blind controlled trial | journal = Journal of Neurology, Neurosurgery, and Psychiatry | volume = 49 | issue = 4 | pages = 390–395 | date = April 1986 | pmid = 3517235 | pmc = 1028763 | doi = 10.1136/jnnp.49.4.390 }} It was also investigated for the treatment of hyperprolactinemia (high prolactin levels).{{cite journal | vauthors = Bankowski BJ, Zacur HA | title = Dopamine agonist therapy for hyperprolactinemia | journal = Clinical Obstetrics and Gynecology | volume = 46 | issue = 2 | pages = 349–362 | date = June 2003 | pmid = 12808385 | doi = 10.1097/00003081-200306000-00013 | s2cid = 29368668 }}

References

{{Reflist}}

{{Dopamine receptor modulators}}

{{Serotonin receptor modulators}}

{{Ergolines}}

Category:5-HT6 agonists

Category:Abandoned drugs

Category:Dopamine agonists

Category:Ergolines

Category:Prolactin inhibitors

Category:Serotonin receptor antagonists

Category:Sulfamides

{{Nervous-system-drug-stub}}