methadone intermediate
{{Short description|Chemical compound}}
{{Infobox drug
| IUPAC_name = 4-cyano-2-dimethylamino-4,4-diphenylbutane
| image = Methadone Intermediate Structure.svg
| image_class = skin-invert-image
| width = 160
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU = S9
| legal_BR = A1
| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-04-04}}
| legal_CA =
| legal_UK =
| legal_US =
| legal_UN = N I
| legal_DE = Anlage II
| routes_of_administration = N/A
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 125-79-1
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 0GYB2HJA89
| ATC_prefix = none
| ATC_suffix =
| PubChem = 31331
| DrugBank =
| KEGG = C22686
| ChemSpiderID = 29065
| C=19 | H=22 | N=2
| smiles = CC(CC(C#N)(C1=CC=CC=C1)C2=CC=CC=C2)N(C)C
| StdInChI = 1S/C19H22N2/c1-16(21(2)3)14-19(15-20,17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-13,16H,14H2,1-3H3
| StdInChIKey = GJJQIGFCGLPOQK-UHFFFAOYSA-N
}}
Methadone intermediate (pre-methadone, methadone nitrile, dimethylaminodiphenylbutanonitrile) is a methadone precursor scheduled by UN Single Convention on Narcotic Drugs. It is a Schedule II Narcotic controlled substance in the United States and has an ACSCN of 9254. The 2014 annual manufacturing quota was 32 875 kilos.{{Cite web |url=http://www.deadiversion.usdoj.gov/quotas/conv_factor/index.html |title=Quotas - Conversion Factors for Controlled Substances |access-date=2016-02-28 |archive-date=2016-03-02 |archive-url=https://web.archive.org/web/20160302162948/http://deadiversion.usdoj.gov/quotas/conv_factor/index.html |url-status=dead }} It is listed as a Schedule I drug in Canada,{{cite web | url = https://laws-lois.justice.gc.ca/eng/acts/c-38.8/page-9.html | title = Controlled Drugs and Substances Act (S.C. 1996, c. 19) | work = Justice Laws Website | date = 24 November 2023 | publisher = Government of Canada }} but is only significant as a precursor for methadone, as it does not have analgesic activity in its own right, though it does show some atropine-like activity.{{ cite book | vauthors = Janssen PA | chapter = VII Nitriles | series = Synthetic Analgesics | volume = 1 | title = Diphenylpropylamines | publisher = Pergamon Press | year = 1960 | pages = 122–128 | lccn = 59-13814 | url = }}
See also
- Moramide intermediate
- Pethidine intermediate A
- Pethidine intermediate B (norpethidine)
- Pethidine intermediate C (pethidinic acid)