methantheline

{{Short description|Chemical compound}}

{{notability|date=March 2017}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| class = Antimuscarinic

| verifiedrevid = 376104968

| IUPAC_name = N,N-diethyl-N-methyl-2-[(9H-xanthen-9-ylcarbonyl)oxy]-ethanaminium

| image = methantheline.png

| tradename = Banthine, Vagantil, others

| Drugs.com =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = By mouth

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 5818-17-7

| ATC_prefix = A03

| ATC_suffix = AB07

| PubChem = 4097

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 3955

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 36EI79TX7I

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1201264

| C = 21

| H = 26

| N = 1

| O = 3

| smiles = CC[N+](C)(CC)CCOC(=O)C1C2=CC=CC=C2OC3=CC=CC=C13

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C21H26NO3/c1-4-22(3,5-2)14-15-24-21(23)20-16-10-6-8-12-18(16)25-19-13-9-7-11-17(19)20/h6-13,20H,4-5,14-15H2,1-3H3/q+1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = GZHFODJQISUKAY-UHFFFAOYSA-N

}}

Methantheline is an antimuscarinic.{{cite journal | vauthors = McHardy GG, Browne DC, Marek FH, McHardy R, Ward S | title = Clinical evaluation of methantheline (banthine) bromide in gastroenterology | journal = Journal of the American Medical Association | volume = 147 | issue = 17 | pages = 1620–6 | date = December 1951 | pmid = 14880413 | doi = 10.1001/jama.1951.03670340010003 }}