methastyridone

{{Short description|Group of stereoisomers}}

{{Drugbox

| IUPAC_name = 2,2-dimethyl-5-[(E)-2-phenylethenyl]-1,3-oxazolidin-4-one

| image = Methastyridone.svg

| width =

| tradename =

| CAS_number = 721-19-7

| ATC_prefix = none

| PubChem = 6083100

| ChemSpiderID = 4801920

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = C1846N9AVW

| synonyms =

| C=13 | H=15 | N=1 | O=2

| smiles = CC1(C)NC(=O)C(O1)\C=C\c2ccccc2

| StdInChI = 1S/C13H15NO2/c1-13(2)14-12(15)11(16-13)9-8-10-6-4-3-5-7-10/h3-9,11H,1-2H3,(H,14,15)/b9-8+

| StdInChIKey = VEZXEOWXHFHYHC-CMDGGOBGSA-N

}}

Methastyridone is a centrally acting stimulant, whose mode of action differs from that of classical agents such as d-amphetamine.{{cite book | title = Dictionary of pharmacological agents. | location = London | publisher = Chapman & Hall | date = 1997 }}{{cite journal | vauthors = Kurkland AA, Arbona L, McCusker K | title = Clinical trial of methastyridone (MK-202) with chronic anergic schzophrenics | journal = The Journal of Nervous and Mental Disease | volume = 133 | issue = 2| pages = 174–5 | date = August 1961 | pmid = 14460735 | doi = 10.1097/00005053-196108000-00015 }}{{cite book | vauthors = Rasmussen N | author-link = Nicolas Rasmussen | url = https://books.google.com/books?id=1mf5eEG0nRUC&q=Dexamyl+%22purple+heart%22&pg=PA154 | title = On speed: the many lives of amphetamine | publisher = New York University Press | location = New York | date = 2008 | pages = 154–155 | isbn = 9780814776278 }}