methazolamide
{{Short description|Chemical compound}}
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{distinguish|Thiamazole{{!}}methimazole|metamizole|acetazolamide}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 462249727
| IUPAC_name = N-[5-(aminosulfonyl)-3-methyl-1,3,4-thiadiazol-2(3H)-ylidene]acetamide
| image = Methazolamide.svg
| width = 220
| image2 = Methazolamide molecule ball.png
| alt2 = Ball-and-stick model of the methazolamide molecule
| tradename =
| Drugs.com = {{drugs.com|monograph|methazolamide}}
| MedlinePlus = a601233
| pregnancy_AU =
| pregnancy_US = C
| pregnancy_category =
| legal_AU =
| legal_UK =
| legal_US = Rx-only
| legal_status =
| routes_of_administration = Oral
| bioavailability =
| protein_bound = ~55%
| metabolism =
| elimination_half-life = ~14 hours
| excretion =
| IUPHAR_ligand = 6828
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 554-57-4
| ATC_prefix = S01
| ATC_suffix = EC05
| ATC_supplemental =
| PubChem = 4100
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00703
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 3958
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = W733B0S9SD
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = D00655
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 19
| C=5 | H=8 | N=4 | O=3 | S=2
| smiles = O=S(=O)(C\1=N\N(C(=N/C(=O)C)/S/1)C)N
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C5H8N4O3S2/c1-3(10)7-4-9(2)8-5(13-4)14(6,11)12/h1-2H3,(H2,6,11,12)/b7-4-
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = FLOSMHQXBMRNHR-DAXSKMNVSA-N
| synonyms = N-(3-Methyl-5-sulfamoyl-3H-1,3,4-thiadiazol-2-ylidene) ethanamide
}}
Methazolamide (trade name Neptazane) is a potent carbonic anhydrase inhibitor. It is indicated in the treatment of increased intraocular pressure (IOP) in chronic open-angle glaucoma and secondary glaucoma. Also it is used preoperatively in acute angle-closure (narrow-angle) glaucoma where lowering the IOP is desired before surgery.
This drug has displayed teratogenic effects in rats. Compared to another drug in the same class, acetazolamide, methazolamide requires a lower dose when administered to patients.
Recently, research has also uncovered a potential new role for this drug, addressing tau toxicity, a theorized cause for diseases such as Alzheimer’s. {{cite journal | vauthors = Lopez A, Siddiqi FH, Villeneuve J, Ureshino RP, Jeon HY, Koulousakis P, Keeling S, McEwan WA, Fleming A, Rubinsztein DC | title = Carbonic anhydrase inhibition ameliorates tau toxicity via enhanced tau secretion | journal = Nature Chemical Biology | pages = 577–587 | date = October 2024 | volume = 21 | issue = 4 | pmid = 39482469 | doi = 10.1038/s41589-024-01762-7 | doi-access = free | pmc = 11949835 }}
References
{{Reflist}}
Further reading
{{refbegin}}
- {{cite journal | vauthors = Iyer GR, Bellantone RA, Taft DR | title = In vitro characterization of the erythrocyte distribution of methazolamide: a model of erythrocyte transport and binding kinetics | journal = Journal of Pharmacokinetics and Biopharmaceutics | volume = 27 | issue = 1 | pages = 45–66 | date = February 1999 | pmid = 10533697 | doi = 10.1023/A:1020630712388 | s2cid = 24294348 }}
- {{cite web | author = RxList | url = http://www.rxlist.com/cgi/generic2/methaz.htm | title = Neptazane | access-date = August 20, 2006 | archive-url = https://web.archive.org/web/20060812234553/http://www.rxlist.com/cgi/generic2/methaz.htm | archive-date = August 12, 2006 | url-status = dead }}
- {{cite journal | vauthors = Shirato S, Kagaya F, Suzuki Y, Joukou S | title = Stevens-Johnson syndrome induced by methazolamide treatment | journal = Archives of Ophthalmology | volume = 115 | issue = 4 | pages = 550–553 | date = April 1997 | pmid = 9109770 | doi = 10.1001/archopht.1997.01100150552021 }}
- {{cite journal | vauthors = Skorobohach BJ, Ward DA, Hendrix DV | title = Effects of oral administration of methazolamide on intraocular pressure and aqueous humor flow rate in clinically normal dogs | journal = American Journal of Veterinary Research | volume = 64 | issue = 2 | pages = 183–187 | date = February 2003 | pmid = 12602587 | doi = 10.2460/ajvr.2003.64.183 | doi-access = free }}
{{refend}}
{{Antiglaucoma preparations and miotics}}
Category:Carbonic anhydrase inhibitors
{{antihypertensive-stub}}