methenmadinone

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = (8S,9S,10R,13S,14S,17S)-17-Acetyl-10,13-dimethyl-16-methylidene-2,8,9,11,12,14,15,17-octahydro-1H-cyclopenta[a]phenanthren-3-one

| image = Methenmadinone.svg

| width =

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| class = Progestogen; Progestin

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 6723-96-2

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 22809370

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID =

| UNII =

| KEGG =

| ChEBI =

| ChEMBL =

| synonyms = Deacetylsuperlutin; 16-Methylene-6-dehydro-17α-hydroxyprogesterone; 16-Methylenepregna-4,6-diene-3,20-dione; 16-Methyl-4,6,16-pregnatriene-3,20-dione

| C=22 | H=28 | O=2

| SMILES = CC(=O)[C@H]1C(=C)C[C@@H]2[C@@]1(CC[C@H]3[C@H]2C=CC4=CC(=O)CC[C@]34C)C

| StdInChI_Ref =

| StdInChI = 1S/C22H28O2/c1-13-11-19-17-6-5-15-12-16(24)7-9-21(15,3)18(17)8-10-22(19,4)20(13)14(2)23/h5-6,12,17-20H,1,7-11H2,2-4H3/t17-,18+,19+,20-,21+,22+/m1/s1

| StdInChIKey_Ref =

| StdInChIKey = SLRUDSFURBMIQT-HQZKGGBDSA-N

}}

Methenmadinone, also known as deacetylsuperlutin or as 16-methylene-6-dehydro-17α-hydroxyprogesterone, is a pregnane steroid which was never marketed.{{cite book|author=G.W.A Milne|title=Ashgate Handbook of Endocrine Agents and Steroids|url=https://books.google.com/books?id=GFM8DwAAQBAJ&pg=PT158|date=1 November 2017|publisher=Taylor & Francis|isbn=978-1-351-74347-1|pages=158–}}{{cite book|author=George W.A Milne|title=Drugs: Synonyms and Properties: Synonyms and Properties|url=https://books.google.com/books?id=xUlaDwAAQBAJ&pg=PT1572|date=8 May 2018|publisher=Taylor & Francis|isbn=978-1-351-78989-9|pages=1572–}}{{cite journal | vauthors = Shapiro EL, Weber L, Harris H, Miskowicz C, Neri R, Herzog HL | title = Synthesis and biological activity of 17-esters of 6-dehydro-16-methylene-17 -hydroxyprogesterones | journal = J. Med. Chem. | volume = 15 | issue = 7 | pages = 716–20 | date = July 1972 | pmid = 5043870 | doi = 10.1021/jm00277a006 }} It is a parent compound of methenmadinone acetate (the C17α acetate ester), melengestrol (the C6 methyl derivative), and chlormethenmadinone (the C6 chloro derivative).