methyl p-toluate
{{DISPLAYTITLE:Methyl p-toluate}}
{{Chembox
| Name = Methyl p-toluate
| ImageFile = Methyl p-toluate.png
| ImageSize = 144
| ImageAlt =
| PIN = Methyl 4-methylbenzoate
| OtherNames =
|Section1={{Chembox Identifiers
| CASNo = 99-75-2
| PubChem = 7455
| ChemSpiderID = 7175
| UNII = 964JP0ZZRG
| EC_number = 202-784-1
| ChEMBL = 1480173
| SMILES = CC1=CC=C(C=C1)C(=O)OC
| StdInChI=1S/C9H10O2/c1-7-3-5-8(6-4-7)9(10)11-2/h3-6H,1-2H3
| StdInChIKey = QSSJZLPUHJDYKF-UHFFFAOYSA-N
}}
|Section2={{Chembox Properties
| C=9|H=10|O=2
| Appearance = White solid
| Density = 1.058
| MeltingPtC = 32-35
| MeltingPt_notes =
| BoilingPt = 222.4
| Solubility = }}
|Section3={{Chembox Hazards
| GHSPictograms = {{GHS05}}{{GHS07}}
| GHSSignalWord = Danger
| HPhrases = {{H-phrases|315|317|318|319|335}}
| PPhrases = {{P-phrases|261|264|271|272|280|302+352|304+340|305+351+338|310|312|321|332+313|333+313|337+313|362|363|403+233|405|501}}
| MainHazards =
| FlashPtC = 95.5
| AutoignitionPt = }}
}}
Methyl p-toluate is the organic compound with the formula CH3C6H4CO2CH3. It is a waxy white solid that is soluble in common organic solvents. It is the methyl ester of p-toluic acid. Methyl p-toluate per se is not particularly important but is an intermediate in some routes to dimethyl terephthalate, a commodity chemical.{{cite journal|title=p-Xylene Oxidation to Terephthalic Acid: A Literature Review Oriented toward Process Optimization and Development|author1=Tomas, Rogerio A. F. |author2=Bordado, Joao C. M. |author3=Gomes, Joao F. P. |journal=Chemical Reviews|year=2013|volume=113|issue=10 |pages=7421–69 |doi=10.1021/cr300298j |pmid=23767849}}