methylglucoside

{{Chembox

| ImageFileL1 = alpha-methylglucoside.svg

| ImageCaptionL1 = α-D-Methylglucoside

| ImageFileR1 = beta-methylglucoside.svg

| ImageCaptionR1 = β-D-Methylglucoside

| IUPACName = Methyl D-glucopyranoside

| OtherNames = 1-O-Methyl-D-glucopyranose

|Section1={{Chembox Identifiers

| CASNo = 3149-68-6

| CASNo_Ref = {{cascite|correct|}}

| CASNo1 = 97-30-3

| CASNo1_Ref = {{cascite|correct|}}

| CASNo1_Comment = (α)

| CASNo2 = 709-50-2

| CASNo2_Ref = {{cascite|correct|}}

| CASNo2_Comment = (β)

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 54L5T38NI8

| UNII1_Ref = {{fdacite|correct|FDA}}

| UNII1 = QCF122NF3R

| UNII1_Comment = (α)

| PubChem = 3036743

| ChemSpiderID = 2300694

| SMILES = O[C@@H]1[C@@H](O)[C@H](O)[C@H](OC1OC)CO

| InChI = 1/C7H14O6/c1-12-7-6(11)5(10)4(9)3(2-8)13-7/h3-11H,2H2,1H3/t3-,4-,5+,6-,7?/m1/s1

| InChIKey = HOVAGTYPODGVJG-WLDMJGECBG

| StdInChI = 1S/C7H14O6/c1-12-7-6(11)5(10)4(9)3(2-8)13-7/h3-11H,2H2,1H3/t3-,4-,5+,6-,7?/m1/s1

| StdInChIKey = HOVAGTYPODGVJG-WLDMJGECSA-N

}}

|Section2={{Chembox Properties

| C=7 | H=14 | O=6

| Appearance = White crystalline solid

| Density = 1.46 g/cm3 (α)Merck Index, 11th Edition, 5997

| MeltingPtC = 168

| MeltingPt_notes = (α)

| BoilingPt =

| Solubility = 108 g/100 mL

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Methylglucoside is a monosaccharide derived from glucose. It can be prepared in the laboratory by the acid-catalyzed reaction of glucose with methanol.{{OrgSynth| author = B. Helferich and W. Schäfer | year = 1926 | title = α-METHYL d-GLUCOSIDE | volume = 6 | pages = 64 | Collvol = 1 | collvolpages = 364 |prep=cv1p0364}}

It is used as a chemical intermediate in the production of a variety of products including emollients, emulsifiers, humectants, moisturizers, thickening agents, plasticizers, surfactants, varnishes, and resins. The formation of methyl glycoside indicates that the structure of glucose is not open chain.{{cite web | url = http://www.lubrizol.com/PersonalCare/Products/MethylGlucosideDerivatives/default.html | title = Methyl Glucoside Derivatives | publisher = Lubrizol | accessdate = October 15, 2012 | archive-url = https://web.archive.org/web/20140414113630/http://www.lubrizol.com/PersonalCare/Products/MethylGlucosideDerivatives/default.html | archive-date = April 14, 2014 | url-status = dead }}

References

{{reflist}}

Category:Glucosides

{{Carbohydrate-stub}}