methylglucoside
{{Chembox
| ImageFileL1 = alpha-methylglucoside.svg
| ImageCaptionL1 = α-D-Methylglucoside
| ImageFileR1 = beta-methylglucoside.svg
| ImageCaptionR1 = β-D-Methylglucoside
| IUPACName = Methyl D-glucopyranoside
| OtherNames = 1-O-Methyl-D-glucopyranose
|Section1={{Chembox Identifiers
| CASNo = 3149-68-6
| CASNo_Ref = {{cascite|correct|}}
| CASNo1 = 97-30-3
| CASNo1_Ref = {{cascite|correct|}}
| CASNo1_Comment = (α)
| CASNo2 = 709-50-2
| CASNo2_Ref = {{cascite|correct|}}
| CASNo2_Comment = (β)
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 54L5T38NI8
| UNII1_Ref = {{fdacite|correct|FDA}}
| UNII1 = QCF122NF3R
| UNII1_Comment = (α)
| PubChem = 3036743
| ChemSpiderID = 2300694
| SMILES = O[C@@H]1[C@@H](O)[C@H](O)[C@H](OC1OC)CO
| InChI = 1/C7H14O6/c1-12-7-6(11)5(10)4(9)3(2-8)13-7/h3-11H,2H2,1H3/t3-,4-,5+,6-,7?/m1/s1
| InChIKey = HOVAGTYPODGVJG-WLDMJGECBG
| StdInChI = 1S/C7H14O6/c1-12-7-6(11)5(10)4(9)3(2-8)13-7/h3-11H,2H2,1H3/t3-,4-,5+,6-,7?/m1/s1
| StdInChIKey = HOVAGTYPODGVJG-WLDMJGECSA-N
}}
|Section2={{Chembox Properties
| C=7 | H=14 | O=6
| Appearance = White crystalline solid
| Density = 1.46 g/cm3 (α)Merck Index, 11th Edition, 5997
| MeltingPtC = 168
| BoilingPt =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Methylglucoside is a monosaccharide derived from glucose. It can be prepared in the laboratory by the acid-catalyzed reaction of glucose with methanol.{{OrgSynth| author = B. Helferich and W. Schäfer | year = 1926 | title = α-METHYL d-GLUCOSIDE | volume = 6 | pages = 64 | Collvol = 1 | collvolpages = 364 |prep=cv1p0364}}
It is used as a chemical intermediate in the production of a variety of products including emollients, emulsifiers, humectants, moisturizers, thickening agents, plasticizers, surfactants, varnishes, and resins. The formation of methyl glycoside indicates that the structure of glucose is not open chain.{{cite web | url = http://www.lubrizol.com/PersonalCare/Products/MethylGlucosideDerivatives/default.html | title = Methyl Glucoside Derivatives | publisher = Lubrizol | accessdate = October 15, 2012 | archive-url = https://web.archive.org/web/20140414113630/http://www.lubrizol.com/PersonalCare/Products/MethylGlucosideDerivatives/default.html | archive-date = April 14, 2014 | url-status = dead }}