methylprednisolone succinate

{{Short description|Chemical compound}}

{{Use dmy dates|date=December 2023}}

{{cs1 config |name-list-style=vanc |display-authors=6}}

{{Infobox drug

| image = Methylprednisolone sodium succinate.svg

| width = 250

| alt =

| caption =

| pronounce =

| tradename = Solu-Medrol, Solu-Medrone, Urbason, others

| Drugs.com = {{drugs.com|monograph|methylprednisolone}}

| MedlinePlus =

| DailyMedID = Methylprednisolone succinate

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category =

| routes_of_administration = Intravenous injection

| class = Corticosteroid; Glucocorticoid

| ATC_prefix = D07

| ATC_suffix = AA01

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA = Rx-only

| legal_CA_comment = {{cite web | title=Solu-Medrol Product information | website=Health Canada | date=3 February 2009 | url=https://health-products.canada.ca/dpd-bdpp/info?lang=eng&code=1132 | access-date=19 April 2024}}

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US = Rx-only

| legal_US_comment = {{cite web | title=Solu-Medrol- methylprednisolone sodium succinate injection, powder, for solution | website=DailyMed | date=17 December 2021 | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=7271310c-7764-4812-aa30-a5e90987c7a9 | access-date=23 December 2023}}

| legal_EU =

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 2921-57-5

| PubChem = 16923

| IUPHAR_ligand =

| DrugBank = DB14644

| ChemSpiderID = 16034

| UNII = 5GMR90S4KN

| KEGG = D05000

| ChEBI = 135765

| ChEMBL = 1201265

| synonyms = Methylprednisolone hemisuccinate; 6α-Methylprednisolone 21-hemisuccinate

| IUPAC_name = 4-[2-[(6S,8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]-4-oxobutanoic acid

| C=26 | H=34 | O=8

| SMILES = C[C@H]1C[C@H]2[C@@H]3CC[C@@]([C@]3(C[C@@H]([C@@H]2[C@@]4(C1=CC(=O)C=C4)C)O)C)(C(=O)COC(=O)CCC(=O)O)O

| StdInChI = 1S/C26H34O8/c1-14-10-16-17-7-9-26(33,20(29)13-34-22(32)5-4-21(30)31)25(17,3)12-19(28)23(16)24(2)8-6-15(27)11-18(14)24/h6,8,11,14,16-17,19,23,28,33H,4-5,7,9-10,12-13H2,1-3H3,(H,30,31)/t14-,16-,17-,19-,23+,24-,25-,26-/m0/s1

| StdInChIKey = IMBXEJJVJRTNOW-XYMSELFBSA-N

}}

Methylprednisolone succinate, sold under the brand name Solu-Medrol among others, is a synthetic glucocorticoid corticosteroid and a corticosteroid ester—specifically the C21 succinate ester of methylprednisolone—which is used by intravenous administration.{{cite book | vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA811|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=811–}}{{cite book|title=Index Nominum 2000: International Drug Directory|url=https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA675|year=2000|publisher=Taylor & Francis|isbn=978-3-88763-075-1|pages=675–}} Methylprednisolone succinate is provided as two different salts when used as a pharmaceutical drug: a sodium salt (methylprednisolone sodium succinate; brand name Solu-Medrol, others) and a hydrogen salt (methylprednisolone hemisuccinate or methylprednisolone hydrogen succinate; brand name Urbason).

Methylprednisolone succinate was approved for medical use in the United States in 1959.