metogest

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 17β-Hydroxy-16,16-dimethylestr-4-en-3-one

| image = Metogest.svg

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 52279-58-0

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = BPY4IK3W14

| ATC_prefix = None

| ATC_suffix =

| PubChem = 9839398

| DrugBank =

| ChemSpiderID = 8015116

| C=20 | H=30 | O=2

| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CC([C@@H]2O)(C)C)CCC4=CC(=O)CC[C@H]34

| StdInChI = 1S/C20H30O2/c1-19(2)11-17-16-6-4-12-10-13(21)5-7-14(12)15(16)8-9-20(17,3)18(19)22/h10,14-18,22H,4-9,11H2,1-3H3/t14-,15+,16+,17-,18-,20-/m0/s1

| StdInChIKey = JYCITEUSLNKPHC-URNBORRASA-N

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category=

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

}}

Metogest (INN, USAN) (developmental code name SC-14207), also known as 16,16-dimethyl-19-nortestosterone, is a steroidal antiandrogen that was patented in 1975 and investigated as a treatment for acne but was never marketed.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA816|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=816–}}{{cite book| vauthors = Hill RA, Makin HL, Kirk DN, Murphy GM |title=Dictionary of Steroids|url=https://books.google.com/books?id=qw5X0NK1A90C&pg=PA676|date=23 May 1991|publisher=CRC Press|isbn=978-0-412-27060-4|pages=676–}}{{cite book| vauthors = Horsky J, Presl J |title=Ovarian Function and its Disorders: Diagnosis and Therapy|url=https://books.google.com/books?id=7IrpCAAAQBAJ&pg=PA112|date=6 December 2012|publisher=Springer Science & Business Media|isbn=978-94-009-8195-9|pages=112–}}