metomidate

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 459444292

| IUPAC_name = methyl 1-(1-phenylethyl)-1H-imidazole-5-carboxylate

| image = Metomidate.svg

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 5377-20-8

| ATCvet = yes

| ATC_prefix = N05

| ATC_suffix = CM94

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = Z18ZYL8Y51

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 494039

| PubChem = 21474

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 20182

| C = 13 | H = 14 | N = 2 | O = 2

| smiles = O=C(OC)c1cncn1C(c2ccccc2)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C13H14N2O2/c1-10(11-6-4-3-5-7-11)15-9-14-8-12(15)13(16)17-2/h3-10H,1-2H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = FHFZEKYDSVTYLL-UHFFFAOYSA-N

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_category =

| legal_status = Rx-only

| routes_of_administration =

}}

Metomidate is a non-barbiturate imidazole that was discovered by Janssen Pharmaceutica in 1965BE Patent 662474 and under the names (Hypnodil, Nokemyl) is sold as a sedative-hypnotic drug used in Europe to treat humans and for veterinary purposes.{{cite book | title = Index nominum 2000: international drug directory | url = https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA683 | access-date = 27 October 2011 | year = 2000 | publisher = Taylor & Francis US | isbn = 978-3-88763-075-1 | pages = 683}}

¹¹C-labelled metomidate (11C-metomidate), may be used with positron emission tomography (PET). For instance, to detect tumors of adrenocortical origin.{{cite journal | vauthors = Khan TS, Sundin A, Juhlin C, Långström B, Bergström M, Eriksson B | title = 11C-metomidate PET imaging of adrenocortical cancer | journal = European Journal of Nuclear Medicine and Molecular Imaging | volume = 30 | issue = 3 | pages = 403–10 | date = March 2003 | pmid = 12634969 | doi = 10.1007/s00259-002-1025-9 | s2cid = 23744095 }}{{cite journal | vauthors = Minn H, Salonen A, Friberg J, Roivainen A, Viljanen T, Långsjö J, Salmi J, Välimäki M, Någren K, Nuutila P | display-authors = 6 | title = Imaging of adrenal incidentalomas with PET using (11)C-metomidate and (18)F-FDG | journal = Journal of Nuclear Medicine | volume = 45 | issue = 6 | pages = 972–9 | date = June 2004 | pmid = 15181132 | url = http://jnm.snmjournals.org/cgi/content/full/45/6/972 }}