mexrenoate potassium

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = Potassium 3-[(7R,8R,9S,10R,13S,14S,17R)-17-hydroxy-7-methoxycarbonyl-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]propanoate

| image = Mexrenoate potassium.svg

| width =

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 41020-67-1

| CAS_supplemental =

| class = Antimineralocorticoid

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 23667632

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 58288

| UNII = AZR13V2X75

| KEGG =

| ChEBI =

| ChEMBL = 2106906

| C=24 | H=33 | K=1 | O=6

| SMILES = C[C@]12CCC(=O)C=C1C[C@H]([C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@]4(CCC(=O)[O-])O)C)C(=O)OC.[K+]

| StdInChI_Ref =

| StdInChI = 1S/C24H34O6.K/c1-22-8-4-15(25)12-14(22)13-16(21(28)30-3)20-17(22)5-9-23(2)18(20)6-10-24(23,29)11-7-19(26)27;/h12,16-18,20,29H,4-11,13H2,1-3H3,(H,26,27);/q;+1/p-1/t16-,17+,18+,20-,22+,23+,24-;/m1./s1

| StdInChIKey_Ref =

| StdInChIKey = FYLPNLCXMZDAEE-CKPGHUGTSA-M

| synonyms = SC-26714; 7-Methyl 17-hydroxy-3-oxopregn-4-ene-7,21-dicarboxylate monopotassium salt

}}

Mexrenoate potassium (developmental code name SC-26714) is a synthetic steroidal antimineralocorticoid which was never marketed.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA821|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=821–}}{{cite book| vauthors = Morton IK, Hall JM |title=Concise Dictionary of Pharmacological Agents: Properties and Synonyms|url=https://books.google.com/books?id=mqaOMOtk61IC&pg=PA181|date=31 October 1999|publisher=Springer Science & Business Media|isbn=978-0-7514-0499-9|pages=181–}}