midaflur

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 2,2,5,5-Tetrakis(trifluoromethyl)-2,5-dihydro-1H-imidazol-4-amine

| image = midaflur2d.svg

| width = 200

| CAS_number = 23757-42-8

| ATC_prefix = None

| ATC_suffix =

| UNII = 840CTL676L

| DTXSID = DTXSID50178425

| ChEMBL = 2104707

| KEGG = D05027

| PubChem = 32068

| ChemSpiderID = 29737

| C = 7 | H = 3 | N = 3 | F = 12

| smiles = C1(=NC(NC1(C(F)(F)F)C(F)(F)F)(C(F)(F)F)C(F)(F)F)N

| StdInChI = 1S/C7H3F12N3/c8-4(9,10)2(5(11,12)13)1(20)21-3(22-2,6(14,15)16)7(17,18)19/h22H,(H2,20,21)

| StdInChIKey = KYWMWUUMCDZISK-UHFFFAOYSA-N

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_category =

| legal_status =

| routes_of_administration =

}}

Midaflur (INN; EXP 338) is an extremely stable 3-imidazoline derivative with central skeletal muscle relaxant and sedative properties in humans{{cite journal | vauthors = Levine IM, Jossmann PB, Friend DG, DeAngelis V | title = Effect of 5-imino-2,2,4,4-tetrakis (trifluoromethyl) imidazolidine (EXP 338) on spasticity: A quantitative evaluation | journal = Clinical Pharmacology and Therapeutics | volume = 9 | issue = 4 | pages = 448–55 | date = 1967 | pmid = 4871898 | doi = 10.1002/cpt196894448 | s2cid = 39263140 }} and other species of mammals, exhibiting consistently high oral bioavailability and a long duration of action. While its pharmacodynamics remain poorly understood, midaflur resembles meprobamate and pentobarbital in terms of observed effects while being considerably more potent.{{cite journal | vauthors = Clark R, Lynes TE, Price WA, Smith DH, Woodward JK, Marvel JP, Vernier VG | title = The pharmacology and toxicology of midaflur | journal = Toxicology and Applied Pharmacology | volume = 18 | issue = 4 | pages = 917–43 | date = April 1971 | pmid = 5570243 | doi = 10.1016/0041-008x(71)90239-0 }}