miroprofen

{{Short description|Analgesic and NSAID}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 449584845

| IUPAC_name = (RS)-2-(4-imidazo[1,2-a]pyridin-2-ylphenyl)propanoic acid

| image = Miroprofen.svg

| image_class = skin-invert-image

| width = 250px

| chirality = Racemic mixture

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 55843-86-2

| ATC_prefix = none

| ATC_suffix =

| PubChem = 68752

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 76249

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 61997

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = S00I5XG484

| C=16 | H=14 | N=2 | O=2

| smiles = O=C(O)C(c3ccc(c1nc2ccccn2c1)cc3)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C16H14N2O2/c1-11(16(19)20)12-5-7-13(8-6-12)14-10-18-9-3-2-4-15(18)17-14/h2-11H,1H3,(H,19,20)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = OJGQFYYLKNCIJD-UHFFFAOYSA-N

| synonyms = Antopen; BRN 0888858; NSC 261037; Ro 07-0582; Y 9213; 2-[4-(1,7-diazabicyclo[4.3.0]nona-2,4,6,8-tetraen-8-yl)phenyl]propanoic acid

}}

Miroprofen (INN) is an analgesic and NSAID, meaning that it has anti-inflammatory, antipyretic and antiplatelet aggregation activity. Chemically it is a carboxylic acid belonging to the group of phenylpropanoic acids.{{cite journal | vauthors = Mikashima H, Goto K | title = [Inhibitory effect of 2-(4-(2-imidazo(1,2-a)pyridyl)phenyl) propionic acid (miroprofen) on platelet aggregation and prostaglandin I2 generation (author's transl)] | journal = Yakugaku Zasshi | volume = 102 | issue = 1 | pages = 99–103 | date = January 1982 | pmid = 7045328 | doi = 10.1248/yakushi1947.102.1_99| doi-access = free }}