mitiglinide

{{short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 462252797

| IUPAC_name = (−)-(2S,3a,7a-cis)-α-Benzylhexahydro-γ-oxo-2-isoindolinebutyric acid

| image = Mitiglinide.svg

| tradename = Glufast

| Drugs.com = {{drugs.com|international|mitiglinide}}

| routes_of_administration = By mouth (tablets)

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 145375-43-5

| ATC_prefix = A10

| ATC_suffix = BX08

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 471498

| PubChem = 121891

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB01252

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 108739

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = D86I0XLB13

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D01854

| C=19 | H=25 | N=1 | O=3

| smiles = O=C(O)[C@@H](Cc1ccccc1)CC(=O)N3C[C@H]2CCCC[C@H]2C3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C19H25NO3/c21-18(20-12-15-8-4-5-9-16(15)13-20)11-17(19(22)23)10-14-6-2-1-3-7-14/h1-3,6-7,15-17H,4-5,8-13H2,(H,22,23)/t15-,16+,17-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = WPGGHFDDFPHPOB-BBWFWOEESA-N

}}

Mitiglinide (INN,{{cite web|title=International Nonproprietary Names for Pharmaceutical Substances (INN). Recommended International Nonproprietary names (Rec. INN): List 40|url=https://www.who.int/medicines/publications/druginformation/innlists/PL78.pdf|publisher=World Health Organization|access-date=10 November 2016|page=187}} trade name Glufast) is a drug for the treatment of type 2 diabetes.{{cite journal | vauthors = Malaisse WJ | title = Mitiglinide: a rapid- and short-acting non-sulfonylurea insulinotropic agent for the treatment of type 2 diabetic patients | journal = Expert Opinion on Pharmacotherapy | volume = 9 | issue = 15 | pages = 2691–8 | date = October 2008 | pmid = 18803455 | doi = 10.1517/14656566.9.15.2691 | s2cid = 73318104 }}

Mitiglinide belongs to the meglitinide (glinide) class of blood glucose-lowering drugs and is currently co-marketed in Japan by Kissei and Takeda. The North America rights to mitiglinide are held by Elixir Pharmaceuticals. Mitiglinide has not yet gained FDA approval.