mitratapide

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 2-[(2R)-Butan-2-yl]-4-[4-[4-[4-[[(2S,4R)-2-(4-chlorophenyl)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one

| image = Mitratapide.svg

| width = 315

| alt =

| caption =

| tradename = Yarvitan

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_category =

| routes_of_administration = By mouth

| ATCvet = yes

| ATC_prefix = A08

| ATC_suffix = AB90

| legal_AU =

| legal_CA = Rx-only

| legal_CA_comment =

| legal_UK =

| legal_US =

| legal_status =

| bioavailability = 55–69%

| protein_bound = >99.9%{{cite web|title=Yarvitan 5 mg/ml Oral Solution for Dogs. Summary of Product Characteristics|url=http://www.ema.europa.eu/docs/en_GB/document_library/EPAR_-_Product_Information/veterinary/000113/WC500069449.pdf|website=www.ema.europa.eu|access-date=27 August 2016}}

| metabolism = Extensive liver (sulfoxidation); first pass effect

| elimination_half-life = 6.3 hours (mitratapide), up to 44.7 hours (metabolites)

| excretion = Feces (80–90%){{cite web|title=Yarvitan (mitratapide). Scientific Discussion|url=http://www.ema.europa.eu/docs/en_GB/document_library/EPAR_-_Scientific_Discussion/veterinary/000113/WC500069446.pdf|website=www.ema.europa.eu|access-date=27 August 2016}}

| synonyms = Mitratapid; R103757

| CAS_number = 179602-65-4

| PubChem = 213047

| DrugBank =

| ChemSpiderID = 184740

| UNII = FVW7T75XP4

| KEGG = D05060

| C=36 | H=41 | Cl=1 | N=8 | O=4 | S=1

| smiles = CC[C@@H](C)N1C(=O)N(C=N1)C2=CC=C(C=C2)N3CCN(CC3)C4=CC=C(C=C4)OC[C@@H]5CO[C@@](O5)(CSC6=NN=CN6C)C7=CC=C(C=C7)Cl

| StdInChI = 1S/C36H41ClN8O4S/c1-4-26(2)45-35(46)44(25-39-45)31-11-9-29(10-12-31)42-17-19-43(20-18-42)30-13-15-32(16-14-30)47-21-33-22-48-36(49-33,27-5-7-28(37)8-6-27)23-50-34-40-38-24-41(34)3/h5-16,24-26,33H,4,17-23H2,1-3H3/t26-,33-,36-/m1/s1

| StdInChIKey = HQSRVYUCBOCBLY-XOOFNSLWSA-N

}}

Mitratapide is a veterinary medication used for the treatment of overweight and obese dogs sold under the brand name Yarvitan. Its mechanism of action involves inhibition of microsomal triglyceride transfer protein (MTP) which is responsible for the absorption of dietary lipids.[http://www.vetstream.com/canis/Content/Generic/gen00870.asp Mitratapide] {{webarchive|url=https://web.archive.org/web/20120405061345/http://www.vetstream.com/canis/Content/Generic/gen00870.asp |date=2012-04-05 }}, vetstream.com Clinical study also suggests that mitratapide may help to reverse insulin resistance in dogs.{{cite journal | vauthors = Dobenecker B, De Bock M, Engelen M, Goossens L, Scholz A, Kienzle E | title = Effect of mitratapide on body composition, body measurements and glucose tolerance in obese Beagles | journal = Veterinary Research Communications | volume = 33 | issue = 8 | pages = 839–47 | date = December 2009 | pmid = 19544001 | pmc = 2776940 | doi = 10.1007/s11259-009-9232-5 }}

The drug was developed by Janssen Pharmaceutica and is chemically related to the antifungal drugs such as itraconazole which were also developed by Janssen.

Mitratapide (under the brand name Yarvitan) was authorized for use in the EU by the European Medicines Agency for helping weight loss in dogs, but it has since been withdrawn from the market in the EU.{{cite journal | vauthors = German AJ | title = Weight management in obese pets: the tailoring concept and how it can improve results | journal = Acta Veterinaria Scandinavica | volume = 58 | issue = Suppl 1 | pages = 57 | date = October 2016 | pmid = 27766974 | pmc = 5073926 | doi = 10.1186/s13028-016-0238-z | doi-access = free }}

References

{{reflist}}

{{Antiobesity preparations}}

{{Lipid modifying agents}}

Category:Veterinary drugs

Category:Anti-obesity drugs

Category:Piperazines

Category:Phenylpiperazines

Category:Triazoles

Category:Ketals

Category:Sec-Butyl compounds

Category:4-Chlorophenyl compounds

{{gastrointestinal-drug-stub}}

{{veterinary-med-stub}}