molybdocene dihydride

{{Short description|Organomolybdenum compound}}

{{chembox

| verifiedrevid =

| ImageFile = Cp2MoH2.png

| ImageSize =134

| ImageName =

| IUPACName =

| OtherNames = dihydridobis(cyclopentadienyl)molybdenum(IV)

|Section1={{Chembox Identifiers

| CASNo_Ref =

| CASNo = 1291-40-3

| RTECS =

| PubChem =11984635

| ChemSpiderID =

| SMILES = [cH-]1cccc1.[cH-]1cccc1.[H][Mo+2][H]

| InChI=1S/2C5H5.Mo.2H/c2*1-2-4-5-3-1;;;/h2*1-5H;;;/q-5;-1;;;

| InChIKey = QCRPIEJRQZHDSX-UHFFFAOYSA-N

| StdInChI =

| StdInChIKey =

}}

|Section2={{Chembox Properties

| C=10|H=12|Mo=1

| MolarMass =

| Appearance = yellow-brown powder

| Density =

| Solubility = insoluble

| MeltingPtC = 163-165}}

|Section3={{Chembox Structure

| Coordination =

| CrystalStruct =

| Dipole =

}}

|Section7={{Chembox Hazards

| ExternalSDS =

| NFPA-H =

| NFPA-F =

| NFPA-R =

}}

|Section8={{Chembox Related

| OtherCompounds = }}

}}

Molybdocene dihydride is the organomolybdenum compound with the formula (η⁵-C₅H₅)₂MoH₂. Commonly abbreviated as Cp₂MoH₂, it is a yellow air-sensitive solid that dissolves in some organic solvents.

The compound is prepared by combining molybdenum pentachloride, sodium cyclopentadienide, and sodium borohydride.{{cite book | last1 = Silavwe | first1 = Ned D. | last2 = Castellani | first2 = Michael P. | last3 = Tyler | first3 = David R. | chapter = Bis(η ⁵ -Cyclopentadienyl)Molybdenum(IV) Complexes | year = 1992 | title = Inorganic Syntheses | volume = 29 | pages = 204–211 | doi = 10.1002/9780470132609.ch50 | isbn = 9780470132609 }}{{cite journal|title=The Di-π-cyclopentadienyl Hydrides of Tantalum, Molybdenum, and Tungsten|author1=Green, M. L. H. |author2=McCleverty, J. A. |author3=Pratt, L. |author4=Wilkinson, G. |journal=Journal of the Chemical Society|year=1961|pages=4854–9|doi=10.1039/JR9610004854}} The dihydride converts to molybdocene dichloride upon treatment with chloroform.

The compound adopts a "clamshell" structure where the Cp rings are not parallel.K. Prout, T. S. Cameron, R. A. Forder, and in parts S. R. Critchley, B. Denton and G. V. Rees "The crystal and molecular structures of bent bis-π{{nbh}}cyclopentadienyl-metal complexes: (a) bis-π{{nbh}}cyclopentadienyl­dibromo­rhenium(V) tetrafluoroborate, (b) bis-π{{nbh}}cyclopentadienyl­dichloro­molybdenum(IV), (c) bis-π{{nbh}}cyclopentadienyl­hydroxo­methylamino­molybdenum(IV) hexafluorophosphate, (d) bis-π{{nbh}}cyclopentadienyl­ethyl­chloro­molybdenum(IV), (e) bis-π{{nbh}}cyclopentadienyl­dichloro­niobium(IV), (f) bis-π{{nbh}}cyclopentadienyl­dichloro­molybdenum(V) tetrafluoroborate, (g) μ{{nbh}}oxo-bis[bis-π{{nbh}}cyclopentadienyl­chloro­niobium(IV)] tetrafluoroborate, (h) bis-π{{nbh}}cyclopentadienyl­dichloro­zirconium" Acta Crystallogr. 1974, volume B30, pp. 2290–2304. {{doi|10.1107/S0567740874007011}}