monometacrine

{{Short description|Abandoned antidepressant}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name =

| image = Monometacrine.svg

| image_class = skin-invert-image

| width =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class =

| ATC_prefix =

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 4757-49-7

| CAS_supplemental =

| PubChem = 145765

| PubChemSubstance =

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 128589

| UNII = 3FDC82890Y

| KEGG =

| ChEBI =

| ChEMBL = 2104752

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = Desmethyldimetacrine; Nordimetacrine; N-Desmethyldimetacrine; SD-735; NSC-100296

| IUPAC_name = 3-(9,9-dimethylacridin-10-yl)-N-methylpropan-1-amine

| C=19 | H=24 | N=2

| SMILES = CC1(C2=CC=CC=C2N(C3=CC=CC=C31)CCCNC)C

| StdInChI = 1S/C19H24N2/c1-19(2)15-9-4-6-11-17(15)21(14-8-13-20-3)18-12-7-5-10-16(18)19/h4-7,9-12,20H,8,13-14H2,1-3H3

| StdInChIKey = PGSOFANFWNSSRA-UHFFFAOYSA-N

}}

Monometacrine ({{Abbrlink|INN|International Nonproprietary Name}}; developmental code name SD-735), also known as desmethyldimetacrine, is a drug of the tricyclic family described as an antidepressant which was never marketed.{{cite book | vauthors = Elks J | title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies | publisher=Springer US | year=2014 | isbn=978-1-4757-2085-3 | url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA835 | access-date=20 October 2024 | page=835}}{{cite book | vauthors = Negwer M, Scharnow HG | title=Organic-chemical Drugs and Their Synonyms: An International Survey | publisher=Wiley-VCH | issue=v. 3 | year=2001 | isbn=978-3-527-30247-5 | url=https://books.google.com/books?id=zmpqAAAAMAAJ | access-date=20 October 2024 | page=1788}}{{cite web | title= Monometacrine | work = Inxight Drugs | publisher = National Center for Advancing Translational Sciences (NCATS) | url=https://drugs.ncats.io/drug/3FDC82890Y | access-date=20 October 2024}} It was first described in the literature by 1966. The drug is the N-desmethyl analogue of dimetacrine and is a metabolite of dimetacrine.

References