morniflumate

{{short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 447985201

| IUPAC_name = 2-morpholin-4-ylethyl 2-{[3-(trifluoromethyl)phenyl]amino}nicotinate

| image = morniflumate.png

| image_class = skin-invert-image

| tradename =

| Drugs.com = {{drugs.com|international|morniflumate}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 65847-85-0

| ATC_prefix = M01

| ATC_suffix = AX22

| PubChem = 72106

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 65089

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = R133MWH7X1

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D05078

| C=19 | H=20 | F=3 | N=3 | O=3

| smiles = FC(F)(F)c1cc(ccc1)Nc2ncccc2C(=O)OCCN3CCOCC3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C19H20F3N3O3/c20-19(21,22)14-3-1-4-15(13-14)24-17-16(5-2-6-23-17)18(26)28-12-9-25-7-10-27-11-8-25/h1-6,13H,7-12H2,(H,23,24)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = LDXSPUSKBDTEKA-UHFFFAOYSA-N

}}

Morniflumate is a nonsteroidal anti-inflammatory drug (NSAID).{{cite journal | vauthors = Melica A, Donateo L, Gerardi R, Parenti M | title = [A new anti-inflammatory-analgesic-antipyretic, morniflumate, in the treatment of chronic recurring bronchitis] | journal = Rivista Europea per le Scienze Mediche e Farmacologiche = European Review for Medical and Pharmacological Sciences = Revue Européenne Pour les Sciences Médicales et Pharmacologiques | volume = 13 | issue = 1–2 | pages = 51–60 | year = 1991 | pmid = 1796197 }}{{cite journal | vauthors = Civelli M, Vigano T, Acerbi D, Caruso P, Giossi M, Bongrani S, Folco GC | title = Modulation of arachidonic acid metabolism by orally administered morniflumate in man | journal = Agents and Actions | volume = 33 | issue = 3–4 | pages = 233–9 | date = July 1991 | pmid = 1659152 | doi = 10.1007/bf01986568 }}{{cite journal | vauthors = Schiantarelli P, Cadel S, Acerbi D | title = A gastroprotective anti-inflammatory agent: the beta-morpholinoethyl ester of niflumic acid (morniflumate) | journal = Agents and Actions | volume = 14 | issue = 2 | pages = 247–56 | date = February 1984 | pmid = 6608862 | doi = 10.1007/BF01966649 }}