morpheridine

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 447992382

| IUPAC_name = ethyl 1-(2-morpholin-4-ylethyl)-4-phenyl-piperidine-4-carboxylate

| image = Morpheridine2DCSD.svg

| image_class = skin-invert-image

| width = 160

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU = S9

| legal_BR = A1

| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-04-04}}

| legal_CA = Schedule I

| legal_UK = CD

| legal_US = Schedule I

| legal_DE = Anlage I

| legal_UN = P I

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 469-81-8

| ATC_prefix = none

| ATC_suffix =

| PubChem = 61121

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 55069

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 1854GKB41Y

| C=20 | H=30 | N=2 | O=3

| smiles = O=C(OCC)C3(c1ccccc1)CCN(CCN2CCOCC2)CC3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C20H30N2O3/c1-2-25-19(23)20(18-6-4-3-5-7-18)8-10-21(11-9-20)12-13-22-14-16-24-17-15-22/h3-7H,2,8-17H2,1H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = JDEDMCKQPKGSAX-UHFFFAOYSA-N

| synonyms =

}}

Morpheridine (Morpholinoethylnorpethidine){{cite patent | country = US | number = 2795581 | title = Piperidine Compounds and Their Production| inventor = Stern ES, Anderson RJ | assign1 = J.F. McFarlan & Co | gdate = 06/11/1957}} is a 4-phenylpiperidine derivative that is related to the clinically used opioid analgesic drug pethidine (meperidine). It is a strong analgesic with around 4 times the potency of pethidine,{{cite journal | vauthors = Holmes JM | title = Morpholinoethylnorpethidine hydrochloride in obstetrics | journal = The Journal of Obstetrics and Gynaecology of the British Empire | volume = 65 | issue = 1 | pages = 98–9 | date = February 1958 | pmid = 13514558 | doi = 10.1111/j.1471-0528.1958.tb06218.x | s2cid = 1481693 }} and unlike pethidine, does not cause convulsions, although it produces the standard opioid side effects such as sedation and respiratory depression.{{cite journal | vauthors = Green AF, Ward NB | title = Analgesic and other properties of morpholinoethylnorpethidine | journal = British Journal of Pharmacology and Chemotherapy | volume = 11 | issue = 1 | pages = 32–4 | date = March 1956 | pmid = 13304251 | pmc = 1509567 | doi = 10.1111/j.1476-5381.1956.tb01023.x }}

Morpheridine is not currently used in medicine and is a Schedule I drug which is controlled under UN drug conventions.{{ cite web | url = http://www.ukcia.org/pollaw/lawlibrary/singleconventiononnarcoticdrugs1961.php | title = Single convention on drugs 1961 }}