morphinone
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 462255579
| ImageFile = Morphinone.svg
| ImageClass = skin-invert-image
| ImageName = Structural formula
| ImageFile1 = Morphinone molecule spacefill.png
| ImageClass1 = bg-transparent
| ImageName1 = Space-filling model
| IUPACName = (5α)-3-Hydroxy-17-methyl-7,8-didehydro-4,5-epoxy-morphinan-6-one
| OtherNames =
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4573586
| InChI = 1/C17H17NO3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h2-5,10-11,16,19H,6-8H2,1H3/t10-,11+,16-,17-/m0/s1
| InChIKey = PFBSOANQDDTNGJ-YNHQPCIGBO
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C17H17NO3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h2-5,10-11,16,19H,6-8H2,1H3/t10-,11+,16-,17-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = PFBSOANQDDTNGJ-YNHQPCIGSA-N
| CASNo_Ref = {{cascite|changed|??}}
| CASNo = 467-02-7
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 255467
| PubChem = 5459823
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 28MBK63MAW
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 16315
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C01735
| SMILES = O=C1\C=C/[C@H]5[C@@H]4N(CC[C@@]52c3c(O[C@@H]12)c(O)ccc3C4)C
}}
|Section2={{Chembox Properties
| C=17 | H=17 | N=1 | O=3
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}
Morphinone is an opioid that is the intermediate when morphine is being converted to hydromorphone (trade name Dilaudid).{{cite book | title = Comprehensive Natural Products III | isbn = 978-0-08-102691-5 | editor = Hung-Wen (Ben) Liu and Tadhg P. Begley | date = 2020 | publisher = Elsevier }}
Chemical structure
Legal status
Morphinone itself is an active opioid, though its potency is closer to codeine than morphine.{{cn|date=February 2023}} It is, however, an important precursor and would fall under the purview of the Controlled Substances Act within the United States. Its legal status in other countries varies.
References
{{Reflist}}
{{Analgesics}}
{{Opioidergics}}
Category:Semisynthetic opioids
Category:Mu-opioid receptor agonists
{{analgesic-stub}}