moxastine

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 449583321

| IUPAC_name = 2-[1,1-di(phenyl)ethoxy]-N,N-dimethylethanamine

| image = Moxastine.png

| tradename =

| Drugs.com = {{drugs.com|international|moxastine}}

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 3572-74-5

| ATC_prefix = none

| ATC_suffix =

| PubChem = 19142

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = ZSJ254W6SF

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 18062

| C=18 | H=23 | N=1 | O=1

| smiles = CC(C1=CC=CC=C1)(C2=CC=CC=C2)OCCN(C)C

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C18H23NO/c1-18(20-15-14-19(2)3,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13H,14-15H2,1-3H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = BBIMHFSPNXQFAH-UHFFFAOYSA-N

}}

Moxastine (also known as mephenhydramine) is an antihistamine and anticholinergic.{{cite book | vauthors = Saxena AK, Saxena M | chapter = Developments in antihistamines (H1) | veditors = Jucker E | title = Progress in Drug Research / Fortschritte der Arzneimittelforschung / Progrès des recherches pharmaceutiques | date = 1992 | pages = 35–125 | isbn = 978-3-0348-7146-4 | doi = 10.1007/978-3-0348-7144-0_3 }}

It was developed in Czechoslovakia{{cite book | vauthors = Wardell WM |title=Controlling the Use of Therapeutic Drugs An International Comparison |date=1978 |publisher=American Enterprise Institute for Public Policy Research |location=Washington, D.C. |isbn=978-0-8447-3278-7 |page=242}} and sold in hydrochloride form as an antihistamine (Alfadryl).

It is, with 8-chlorotheophylline, a component of cocrystal/salt moxastine teoclate (mephenhydrinate) used as antiemetic (Theadryl; Kinedryl (with caffeine)).