moxaverine

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 447824180

| IUPAC_name = 1-Benzyl-3-ethyl-6,7-dimethoxyisoquinoline

| image = Moxaverine structure.svg

| tradename =

| Drugs.com = {{drugs.com|international|moxaverine}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 10539-19-2

| ATC_prefix = A03

| ATC_suffix = AD30

| PubChem = 70882

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = P3P08Y1XJ4

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07089

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 64045

| C=20 | H=21 | N=1 | O=2

| smiles = CCC1=NC(=C2C=C(C(=CC2=C1)OC)OC)CC3=CC=CC=C3

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C20H21NO2/c1-4-16-11-15-12-19(22-2)20(23-3)13-17(15)18(21-16)10-14-8-6-5-7-9-14/h5-9,11-13H,4,10H2,1-3H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = MYCMTMIGRXJNSO-UHFFFAOYSA-N

}}

Moxaverine has been used in therapy based on the direct vasodilatory effect of the drug, a phosphodiesterase inhibitor,{{cite journal | vauthors = Mannhold R | title = Inhibition of calmodulin dependent c-AMP-phosphodiesterase by moxaverine and papaverine | journal = Arzneimittel-Forschung | volume = 38 | issue = 12 | pages = 1806–8 | date = December 1988 | pmid = 2854468 }} and on its influence on the rheological properties of red blood cells.{{cite journal | vauthors = Schmid-Schönbein H, Schröder S, Grebe R, Artmann G, Eschweiler H, Teitel P | title = Influence of moxaverine hydrochloride on membrane curvature and microsieve filterability of red cells after exposure to hyperosmolarity and lactacidosis | journal = Arzneimittel-Forschung | volume = 38 | issue = 5 | pages = 710–6 | date = May 1988 | pmid = 3415714 }}

Moxaverine hydrochloride (Kollateral forte®, Ursapharm. Saarbrücken, Germany) has been shown to increase ocular blood flow in patients with age-related macular degeneration, primary open angle glaucoma, and to increase choroidal and retrobulbar blood flow in elderly patients with eye diseases associated with hypo-perfusion.{{cite journal | vauthors = Pemp B, Garhofer G, Lasta M, Schmidl D, Wolzt M, Schmetterer L | title = The effects of moxaverine on ocular blood flow in patients with age-related macular degeneration or primary open angle glaucoma and in healthy control subjects | journal = Acta Ophthalmologica | volume = 90 | issue = 2 | pages = 139–45 | date = March 2012 | pmid = 20456253 | doi = 10.1111/j.1755-3768.2010.01878.x | s2cid = 3269602 | doi-access = free }} The ocular efficacy of moxaverine has been explored in the clinic.{{ClinicalTrialsGov|NCT01629680|A Randomized, Placebo-controlled Study Investigating the Effects of Moxaverine on Ocular Blood Flow After Oral Administration in Healthy Subjects}}