muramic acid
{{chembox
| Verifiedfields = changed
| verifiedrevid = 462256044
| ImageFile = Muramic acid.svg
| PIN = 2-[3-Amino-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxypropanoic acid
| SystematicName = 2-
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|changed|CAS}}
| CASNo = 1114-41-6
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = D42T32747Z
| PubChem = 441038
| PubChem_Comment = (2R),(3R,4R,5S,6R)
| PubChem1 = 12313001
| PubChem1_Comment = (),(3R,4R,5S,6R)
| PubChem2 = 44123550
| PubChem2_Comment = (2R),(2R,4R,6R)
| PubChem3 = 45039974
| PubChem3_Comment = (2R),()
| PubChem4 = 433580
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 7992151
| ChemSpiderID_Comment = α-muramic acid
| ChemSpiderID2_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID2 = 389857
| ChemSpiderID2_Comment = muramic acid (mixture of anomers)
| ChemSpiderID3_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID3 = 394190
| ChemSpiderID3_Comment = β-muramic acid
| EINECS = 214-214-9
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C06470
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 7027
| SMILES = CC(OC1C(N)C(O)OC(CO)C1O)C(O)=O
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI=1S/C9H17NO7/c1-3(8(13)14)16-7-5(10)9(15)17-4(2-11)6(7)12/h3-7,9,11-12,15H,2,10H2,1H3,(H,13,14)/t3-,4-,5-,6-,7-,9-/m1/s1
| StdInChI_Comment= Undefined anomers
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = MSFSPUZXLOGKHJ-KTZFPWNASA-N
| Beilstein = 2334586
| 3DMet = L03117
}}
|Section2={{Chembox Properties
| Formula=C9H17NO7
| MolarMass=251.23378
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
}}
}}
Muramic acid is an amino sugar acid. In terms of chemical composition, it is the ether of lactic acid and glucosamine. It occurs naturally as N-acetylmuramic acid in peptidoglycan, whose primary function is a structural component of many typical bacterial cell walls.{{cite web | url = https://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=441038 | title = Muramic acid – Compound Summary | work = PubChem }}