muramic acid

{{chembox

| Verifiedfields = changed

| verifiedrevid = 462256044

| ImageFile = Muramic acid.svg

| PIN = 2-[3-Amino-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxypropanoic acid

| SystematicName = 2-{[3-Amino-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy}propanoic acid

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|changed|CAS}}

| CASNo = 1114-41-6

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = D42T32747Z

| PubChem = 441038

| PubChem_Comment = (2R),(3R,4R,5S,6R)

| PubChem1 = 12313001

| PubChem1_Comment = (),(3R,4R,5S,6R)

| PubChem2 = 44123550

| PubChem2_Comment = (2R),(2R,4R,6R)

| PubChem3 = 45039974

| PubChem3_Comment = (2R),()

| PubChem4 = 433580

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 7992151

| ChemSpiderID_Comment = α-muramic acid

| ChemSpiderID2_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID2 = 389857

| ChemSpiderID2_Comment = muramic acid (mixture of anomers)

| ChemSpiderID3_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID3 = 394190

| ChemSpiderID3_Comment = β-muramic acid

| EINECS = 214-214-9

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C06470

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 7027

| SMILES = CC(OC1C(N)C(O)OC(CO)C1O)C(O)=O

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI=1S/C9H17NO7/c1-3(8(13)14)16-7-5(10)9(15)17-4(2-11)6(7)12/h3-7,9,11-12,15H,2,10H2,1H3,(H,13,14)/t3-,4-,5-,6-,7-,9-/m1/s1

| StdInChI_Comment= Undefined anomers

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = MSFSPUZXLOGKHJ-KTZFPWNASA-N

| Beilstein = 2334586

| 3DMet = L03117

}}

|Section2={{Chembox Properties

| Formula=C₉H₁₇NO₇

| MolarMass=251.23378

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Muramic acid is an amino sugar acid. In terms of chemical composition, it is the ether of lactic acid and glucosamine. It occurs naturally as N-acetylmuramic acid in peptidoglycan, whose primary function is a structural component of many typical bacterial cell walls.{{cite web | url = https://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=441038 | title = Muramic acid – Compound Summary | work = PubChem }}